提交 7ce2ab47 authored 作者: David Warde-Farley's avatar David Warde-Farley

PY3K: Respect PEP 3113 (no more tuple unpacking arguments).

上级 10d68dd8
...@@ -84,7 +84,9 @@ class DotModulo(Op): ...@@ -84,7 +84,9 @@ class DotModulo(Op):
def make_node(self, A, s, m, A2, s2, m2): def make_node(self, A, s, m, A2, s2, m2):
return Apply(self, [A, s, m, A2, s2, m2], [s.type()]) return Apply(self, [A, s, m, A2, s2, m2], [s.type()])
def perform(self, node, (A, s, m, A2, s2, m2), (out, )): def perform(self, node, inputs, outputs):
(A, s, m, A2, s2, m2) = inputs
(out,) = outputs
o1 = matVecModM(A, s, m) o1 = matVecModM(A, s, m)
o2 = matVecModM(A2, s2, m2) o2 = matVecModM(A2, s2, m2)
out[0] = numpy.concatenate((o1, o2)) out[0] = numpy.concatenate((o1, o2))
...@@ -92,7 +94,9 @@ class DotModulo(Op): ...@@ -92,7 +94,9 @@ class DotModulo(Op):
def c_code_cache_version(self): def c_code_cache_version(self):
return (6,) return (6,)
def c_code(self, node, name, (_A, _s, _m, _A2, _s2, _m2), (_z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(_A, _s, _m, _A2, _s2, _m2) = inputs
(_z,) = outputs
return """ return """
int osize = -1; int osize = -1;
if (PyArray_NDIM(%(_A)s) != 2) {PyErr_SetString(PyExc_NotImplementedError, "rank(A) != 2"); %(fail)s;} if (PyArray_NDIM(%(_A)s) != 2) {PyErr_SetString(PyExc_NotImplementedError, "rank(A) != 2"); %(fail)s;}
......
...@@ -925,7 +925,9 @@ class UnaryScalarOp(ScalarOp): ...@@ -925,7 +925,9 @@ class UnaryScalarOp(ScalarOp):
amd_float32 = None amd_float32 = None
amd_float64 = None amd_float64 = None
def c_code_contiguous(self, node, name, (x, ), (z, ), sub): def c_code_contiguous(self, node, name, inputs, outputs, sub):
(x,) = inputs
(z,) = outputs
if (not theano.config.lib.amdlibm or if (not theano.config.lib.amdlibm or
# We compare the dtype AND the broadcast flag # We compare the dtype AND the broadcast flag
# as this function do not broadcast # as this function do not broadcast
...@@ -1008,7 +1010,9 @@ class LT(LogicalComparison): ...@@ -1008,7 +1010,9 @@ class LT(LogicalComparison):
# built-in < don't support complex # built-in < don't support complex
return numpy.less(x, y) return numpy.less(x, y)
def c_code(self, node, name, (x, y), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(x, y) = inputs
(z,) = outputs
if node.inputs[0].type in complex_types: if node.inputs[0].type in complex_types:
raise NotImplementedError() raise NotImplementedError()
return "%(z)s = (%(x)s < %(y)s);" % locals() return "%(z)s = (%(x)s < %(y)s);" % locals()
...@@ -1024,7 +1028,9 @@ class GT(LogicalComparison): ...@@ -1024,7 +1028,9 @@ class GT(LogicalComparison):
# built-in > don't support complex # built-in > don't support complex
return numpy.greater(x, y) return numpy.greater(x, y)
def c_code(self, node, name, (x, y), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(x, y) = inputs
(z,) = outputs
if node.inputs[0].type in complex_types: if node.inputs[0].type in complex_types:
raise NotImplementedError() raise NotImplementedError()
return "%(z)s = (%(x)s > %(y)s);" % locals() return "%(z)s = (%(x)s > %(y)s);" % locals()
...@@ -1040,7 +1046,9 @@ class LE(LogicalComparison): ...@@ -1040,7 +1046,9 @@ class LE(LogicalComparison):
# built-in <= don't support complex # built-in <= don't support complex
return numpy.less_equal(x, y) return numpy.less_equal(x, y)
def c_code(self, node, name, (x, y), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(x, y) = inputs
(z,) = outputs
if node.inputs[0].type in complex_types: if node.inputs[0].type in complex_types:
raise NotImplementedError() raise NotImplementedError()
return "%(z)s = (%(x)s <= %(y)s);" % locals() return "%(z)s = (%(x)s <= %(y)s);" % locals()
...@@ -1056,7 +1064,9 @@ class GE(LogicalComparison): ...@@ -1056,7 +1064,9 @@ class GE(LogicalComparison):
# built-in >= don't support complex # built-in >= don't support complex
return numpy.greater_equal(x, y) return numpy.greater_equal(x, y)
def c_code(self, node, name, (x, y), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(x, y) = inputs
(z,) = outputs
if node.inputs[0].type in complex_types: if node.inputs[0].type in complex_types:
raise NotImplementedError() raise NotImplementedError()
return "%(z)s = (%(x)s >= %(y)s);" % locals() return "%(z)s = (%(x)s >= %(y)s);" % locals()
...@@ -1071,7 +1081,9 @@ class EQ(LogicalComparison): ...@@ -1071,7 +1081,9 @@ class EQ(LogicalComparison):
def impl(self, x, y): def impl(self, x, y):
return x == y return x == y
def c_code(self, node, name, (x, y), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(x, y) = inputs
(z,) = outputs
if node.inputs[0].type in complex_types: if node.inputs[0].type in complex_types:
raise NotImplementedError() raise NotImplementedError()
return "%(z)s = (%(x)s == %(y)s);" % locals() return "%(z)s = (%(x)s == %(y)s);" % locals()
...@@ -1086,7 +1098,9 @@ class NEQ(LogicalComparison): ...@@ -1086,7 +1098,9 @@ class NEQ(LogicalComparison):
def impl(self, x, y): def impl(self, x, y):
return x != y return x != y
def c_code(self, node, name, (x, y), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(x, y) = inputs
(z,) = outputs
if node.inputs[0].type in complex_types: if node.inputs[0].type in complex_types:
raise NotImplementedError() raise NotImplementedError()
return "%(z)s = (%(x)s != %(y)s);" % locals() return "%(z)s = (%(x)s != %(y)s);" % locals()
...@@ -1097,7 +1111,9 @@ class IsNan(FixedLogicalComparison): ...@@ -1097,7 +1111,9 @@ class IsNan(FixedLogicalComparison):
def impl(self, x): def impl(self, x):
return numpy.isnan(x) return numpy.isnan(x)
def c_code(self, node, name, (x, ), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(x,) = inputs
(z,) = outputs
if node.inputs[0].type in complex_types: if node.inputs[0].type in complex_types:
raise NotImplementedError() raise NotImplementedError()
return "%(z)s = isnan(%(x)s);" % locals() return "%(z)s = isnan(%(x)s);" % locals()
...@@ -1108,7 +1124,9 @@ class IsInf(FixedLogicalComparison): ...@@ -1108,7 +1124,9 @@ class IsInf(FixedLogicalComparison):
def impl(self, x): def impl(self, x):
return numpy.isinf(x) return numpy.isinf(x)
def c_code(self, node, name, (x, ), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(x,) = inputs
(z,) = outputs
if node.inputs[0].type in complex_types: if node.inputs[0].type in complex_types:
raise NotImplementedError() raise NotImplementedError()
# Note that the C isinf returns -1 for -Inf and +1 for +Inf, while # Note that the C isinf returns -1 for -Inf and +1 for +Inf, while
...@@ -1136,7 +1154,9 @@ class InRange(LogicalComparison): ...@@ -1136,7 +1154,9 @@ class InRange(LogicalComparison):
return False return False
return True return True
def c_code(self, node, name, (x, low, hi), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(x, low, hi) = inputs
(z,) = outputs
if self.openlow: if self.openlow:
cmp1 = '>' cmp1 = '>'
else: else:
...@@ -1165,7 +1185,9 @@ class InRange(LogicalComparison): ...@@ -1165,7 +1185,9 @@ class InRange(LogicalComparison):
else: else:
return elem.zeros_like() return elem.zeros_like()
def grad(self, (x, low, hi), (gz, )): def grad(self, inputs, gout):
(x, low, hi) = inputs
(gz,) = gout
grads = [] grads = []
for elem in [x, low, hi]: for elem in [x, low, hi]:
grads.append(get_grad(elem)) grads.append(get_grad(elem))
...@@ -1186,10 +1208,14 @@ class Switch(ScalarOp): ...@@ -1186,10 +1208,14 @@ class Switch(ScalarOp):
# backport # backport
# return ift if cond else iff # return ift if cond else iff
def c_code(self, node, name, (cond, ift, iff), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(cond, ift, iff) = inputs
(z,) = outputs
return "%(z)s = %(cond)s ? %(ift)s : %(iff)s;" % locals() return "%(z)s = %(cond)s ? %(ift)s : %(iff)s;" % locals()
def grad(self, (cond, ift, iff), (gz, )): def grad(self, inputs, gout):
(cond, ift, iff) = inputs
(gz,) = gout
first_part = switch(cond, gz, 0.) first_part = switch(cond, gz, 0.)
second_part = switch(cond, 0., gz) second_part = switch(cond, 0., gz)
...@@ -1205,7 +1231,8 @@ class Switch(ScalarOp): ...@@ -1205,7 +1231,8 @@ class Switch(ScalarOp):
return (condition_grad, first_part, second_part) return (condition_grad, first_part, second_part)
def output_types(self, (cond_t, ift_t, iff_t)): def output_types(self, types):
(cond_t, ift_t, iff_t) = types
return upcast_out(ift_t, iff_t) return upcast_out(ift_t, iff_t)
switch = Switch() switch = Switch()
...@@ -1249,7 +1276,9 @@ class OR(BinaryBitOp): ...@@ -1249,7 +1276,9 @@ class OR(BinaryBitOp):
def impl(self, x, y): def impl(self, x, y):
return x | y return x | y
def c_code(self, node, name, (x, y), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(x, y) = inputs
(z,) = outputs
return "%(z)s = (%(x)s | %(y)s);" % locals() return "%(z)s = (%(x)s | %(y)s);" % locals()
or_ = OR() or_ = OR()
...@@ -1262,7 +1291,9 @@ class XOR(BinaryBitOp): ...@@ -1262,7 +1291,9 @@ class XOR(BinaryBitOp):
def impl(self, x, y): def impl(self, x, y):
return x ^ y return x ^ y
def c_code(self, node, name, (x, y), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(x, y) = inputs
(z,) = outputs
return "%(z)s = (%(x)s ^ %(y)s);" % locals() return "%(z)s = (%(x)s ^ %(y)s);" % locals()
xor = XOR() xor = XOR()
...@@ -1275,7 +1306,9 @@ class AND(BinaryBitOp): ...@@ -1275,7 +1306,9 @@ class AND(BinaryBitOp):
def impl(self, x, y): def impl(self, x, y):
return x & y return x & y
def c_code(self, node, name, (x, y), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(x, y) = inputs
(z,) = outputs
return "%(z)s = (%(x)s & %(y)s);" % locals() return "%(z)s = (%(x)s & %(y)s);" % locals()
and_ = AND() and_ = AND()
...@@ -1284,7 +1317,9 @@ class Invert(UnaryBitOp): ...@@ -1284,7 +1317,9 @@ class Invert(UnaryBitOp):
def impl(self, x): def impl(self, x):
return ~x return ~x
def c_code(self, node, name, (x,), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(x,) = inputs
(z,) = outputs
return "%(z)s = (~%(x)s);" % locals() return "%(z)s = (~%(x)s);" % locals()
invert = Invert() invert = Invert()
...@@ -1300,14 +1335,18 @@ class Maximum(BinaryScalarOp): ...@@ -1300,14 +1335,18 @@ class Maximum(BinaryScalarOp):
# The built-in max function don't support complex type # The built-in max function don't support complex type
return numpy.maximum(*inputs) return numpy.maximum(*inputs)
def c_code(self, node, name, (x, y), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(x, y) = inputs
(z,) = outputs
if any([i.type in complex_types for i in node.inputs]): if any([i.type in complex_types for i in node.inputs]):
raise NotImplementedError() raise NotImplementedError()
# Test for both y>x and x>=y to detect NaN # Test for both y>x and x>=y to detect NaN
return ('%(z)s = ((%(y)s)>(%(x)s)? (%(y)s): ' return ('%(z)s = ((%(y)s)>(%(x)s)? (%(y)s): '
'((%(x)s)>=(%(y)s)? (%(x)s): nan("")));' % locals()) '((%(x)s)>=(%(y)s)? (%(x)s): nan("")));' % locals())
def grad(self, (x, y), (gz, )): def grad(self, inputs, gout):
(x, y) = inputs
(gz,) = gout
if gz.type in complex_types: if gz.type in complex_types:
# max is currently defined for complex_types, # max is currently defined for complex_types,
# but the gradient for complex is not. # but the gradient for complex is not.
...@@ -1334,13 +1373,17 @@ class Minimum(BinaryScalarOp): ...@@ -1334,13 +1373,17 @@ class Minimum(BinaryScalarOp):
# The built-in min function don't support complex type # The built-in min function don't support complex type
return numpy.minimum(*inputs) return numpy.minimum(*inputs)
def c_code(self, node, name, (x, y), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(x, y) = inputs
(z,) = outputs
if any([i.type in complex_types for i in node.inputs]): if any([i.type in complex_types for i in node.inputs]):
raise NotImplementedError() raise NotImplementedError()
return ('%(z)s = ((%(y)s)<(%(x)s)? (%(y)s): ' return ('%(z)s = ((%(y)s)<(%(x)s)? (%(y)s): '
'((%(x)s)<=(%(y)s)? (%(x)s): nan("")));' % locals()) '((%(x)s)<=(%(y)s)? (%(x)s): nan("")));' % locals())
def grad(self, (x, y), (gz, )): def grad(self, inputs, gout):
(x, y) = inputs
(gz,) = gout
if gz.type in complex_types: if gz.type in complex_types:
# min is currently defined for complex_types, # min is currently defined for complex_types,
# but the gradient for complex is not. # but the gradient for complex is not.
...@@ -1364,13 +1407,15 @@ class Add(ScalarOp): ...@@ -1364,13 +1407,15 @@ class Add(ScalarOp):
def impl(self, *inputs): def impl(self, *inputs):
return sum(inputs) return sum(inputs)
def c_code(self, node, name, inputs, (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(z,) = outputs
if not inputs: if not inputs:
return z + " = 0;" return z + " = 0;"
else: else:
return z + " = " + " + ".join(inputs) + ";" return z + " = " + " + ".join(inputs) + ";"
def grad(self, inputs, (gz, )): def grad(self, inputs, gout):
(gz,) = gout
if gz.type in complex_types: if gz.type in complex_types:
raise NotImplementedError() raise NotImplementedError()
if self(*inputs).type in discrete_types: if self(*inputs).type in discrete_types:
...@@ -1400,13 +1445,15 @@ class Mul(ScalarOp): ...@@ -1400,13 +1445,15 @@ class Mul(ScalarOp):
def impl(self, *inputs): def impl(self, *inputs):
return numpy.product(inputs) return numpy.product(inputs)
def c_code(self, node, name, inputs, (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(z,) = outputs
if not inputs: if not inputs:
return z + " = 1;" return z + " = 1;"
else: else:
return z + " = " + " * ".join(inputs) + ";" return z + " = " + " * ".join(inputs) + ";"
def grad(self, inputs, (gz, )): def grad(self, inputs, gout):
(gz,) = gout
retval = [] retval = []
# The following 3 lines verify that gz is complex when the # The following 3 lines verify that gz is complex when the
...@@ -1448,10 +1495,14 @@ class Sub(BinaryScalarOp): ...@@ -1448,10 +1495,14 @@ class Sub(BinaryScalarOp):
def impl(self, x, y): def impl(self, x, y):
return x - y return x - y
def c_code(self, node, name, (x, y), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(x, y) = inputs
(z,) = outputs
return "%(z)s = %(x)s - %(y)s;" % locals() return "%(z)s = %(x)s - %(y)s;" % locals()
def grad(self, (x, y), (gz, )): def grad(self, inputs, gout):
(x, y) = inputs
(gz,) = gout
if gz.type in complex_types: if gz.type in complex_types:
raise NotImplementedError() raise NotImplementedError()
...@@ -1528,8 +1579,10 @@ class TrueDiv(BinaryScalarOp): ...@@ -1528,8 +1579,10 @@ class TrueDiv(BinaryScalarOp):
else: else:
return x / y return x / y
def c_code(self, node, name, (x, y), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
# we generate good c code only when both are complex! # we generate good c code only when both are complex!
(x, y) = inputs
(z,) = outputs
if sum([node.inputs[0].type in complex_types, if sum([node.inputs[0].type in complex_types,
node.inputs[1].type in complex_types]) == 1: node.inputs[1].type in complex_types]) == 1:
raise NotImplementedError('type not supported', type) raise NotImplementedError('type not supported', type)
...@@ -1538,8 +1591,10 @@ class TrueDiv(BinaryScalarOp): ...@@ -1538,8 +1591,10 @@ class TrueDiv(BinaryScalarOp):
return "%(z)s = ((double)%(x)s) / %(y)s;" % locals() return "%(z)s = ((double)%(x)s) / %(y)s;" % locals()
return "%(z)s = %(x)s / %(y)s;" % locals() return "%(z)s = %(x)s / %(y)s;" % locals()
def grad(self, (x, y), (gz, )): def grad(self, inputs, gout):
(x, y) = inputs
(gz,) = gout
if x.type in complex_types: if x.type in complex_types:
raise NotImplementedError() raise NotImplementedError()
...@@ -1578,7 +1633,9 @@ class IntDiv(BinaryScalarOp): ...@@ -1578,7 +1633,9 @@ class IntDiv(BinaryScalarOp):
# of string formatting. # of string formatting.
return "#define THEANO_MACRO_MOD(x,y) (x % y)" return "#define THEANO_MACRO_MOD(x,y) (x % y)"
def c_code(self, node, name, (x, y), (z,), sub): def c_code(self, node, name, inputs, outputs, sub):
(x, y) = inputs
(z,) = outputs
t = node.inputs[0].type.upcast(*[i.type for i in node.inputs[1:]]) t = node.inputs[0].type.upcast(*[i.type for i in node.inputs[1:]])
if t in imap(str, discrete_types): if t in imap(str, discrete_types):
x_div_y_pp = '(%(x)s / %(y)s)' % locals() x_div_y_pp = '(%(x)s / %(y)s)' % locals()
...@@ -1666,13 +1723,13 @@ class Mod(BinaryScalarOp): ...@@ -1666,13 +1723,13 @@ class Mod(BinaryScalarOp):
# of string formatting. # of string formatting.
return "#define THEANO_MACRO_MOD(x,y) (x % y)" return "#define THEANO_MACRO_MOD(x,y) (x % y)"
def c_code(self, node, name, (x, y), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
""" """
We want the result to have the same sign as python, not the other We want the result to have the same sign as python, not the other
implementation of mod. implementation of mod.
""" """
# raise NotImplementedError("Unlike Python, C's modulo returns negative (x, y) = inputs
# modulo on negative dividend (to implement)") (z,) = outputs
t = node.inputs[0].type.upcast(*[i.type for i in node.inputs[1:]]) t = node.inputs[0].type.upcast(*[i.type for i in node.inputs[1:]])
if (str(t) in imap(str, discrete_types) or if (str(t) in imap(str, discrete_types) or
t in ['uint8', 'int8', 'uint16', 'int16'] or t in ['uint8', 'int8', 'uint16', 'int16'] or
...@@ -1716,7 +1773,9 @@ class Mod(BinaryScalarOp): ...@@ -1716,7 +1773,9 @@ class Mod(BinaryScalarOp):
} }
""") % locals() """) % locals()
def grad(self, (x, y), (gz, )): def grad(self, inputs, gout):
(x, y) = inputs
(gz,) = gout
z = self(x, y) z = self(x, y)
if z.type.dtype in discrete_types: if z.type.dtype in discrete_types:
# The gradient does not flow in if the output is discrete # The gradient does not flow in if the output is discrete
...@@ -1732,13 +1791,17 @@ class Pow(BinaryScalarOp): ...@@ -1732,13 +1791,17 @@ class Pow(BinaryScalarOp):
def impl(self, x, y): def impl(self, x, y):
return x ** y return x ** y
def c_code(self, node, name, (x, y), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(x, y) = inputs
(z,) = outputs
if (node.inputs[0].type in complex_types or if (node.inputs[0].type in complex_types or
node.inputs[1].type in complex_types): node.inputs[1].type in complex_types):
raise NotImplementedError('type not supported', type) raise NotImplementedError('type not supported', type)
return "%(z)s = pow(%(x)s, %(y)s);" % locals() return "%(z)s = pow(%(x)s, %(y)s);" % locals()
def grad(self, (x, y), (gz, )): def grad(self, inputs, gout):
(x, y) = inputs
(gz,) = gout
if gz.type in complex_types: if gz.type in complex_types:
raise NotImplementedError() raise NotImplementedError()
...@@ -1753,7 +1816,9 @@ class Pow(BinaryScalarOp): ...@@ -1753,7 +1816,9 @@ class Pow(BinaryScalarOp):
return (first_part, second_part) return (first_part, second_part)
def c_code_contiguous(self, node, name, (x, y), (z, ), sub): def c_code_contiguous(self, node, name, inputs, outputs, sub):
(x, y) = inputs
(z,) = outputs
if not theano.config.lib.amdlibm: if not theano.config.lib.amdlibm:
raise theano.gof.utils.MethodNotDefined() raise theano.gof.utils.MethodNotDefined()
...@@ -1807,10 +1872,14 @@ class Clip(ScalarOp): ...@@ -1807,10 +1872,14 @@ class Clip(ScalarOp):
else: else:
return x return x
def c_code(self, node, name, (x, min, max), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(x, min, max) = inputs
(z,) = outputs
return "%(z)s = %(x)s < %(min)s ? %(min)s : %(x)s > %(max)s ? %(max)s : %(x)s;" % locals() return "%(z)s = %(x)s < %(min)s ? %(min)s : %(x)s > %(max)s ? %(max)s : %(x)s;" % locals()
def grad(self, (x, mn, mx), (gz, )): def grad(self, inputs, gout):
(x, mn, mx) = inputs
(gz,) = gout
assert gz.type not in complex_types assert gz.type not in complex_types
gx = ((x >= mn) & (x <= mx)) * gz gx = ((x >= mn) & (x <= mx)) * gz
gmn = (x < mn) * gz gmn = (x < mn) * gz
...@@ -1834,7 +1903,9 @@ class Second(BinaryScalarOp): ...@@ -1834,7 +1903,9 @@ class Second(BinaryScalarOp):
def impl(self, x, y): def impl(self, x, y):
return y return y
def c_code(self, node, name, (x, y), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(x, y) = inputs
(z,) = outputs
return "%(z)s = %(y)s;" % locals() return "%(z)s = %(y)s;" % locals()
def connection_pattern(self, node): def connection_pattern(self, node):
...@@ -1844,8 +1915,10 @@ class Second(BinaryScalarOp): ...@@ -1844,8 +1915,10 @@ class Second(BinaryScalarOp):
return [[False], [True]] return [[False], [True]]
def grad(self, (x, y), (gz, )): def grad(self, inputs, gout):
(x, y) = inputs
(gz,) = gout
if y.type in continuous_types: if y.type in continuous_types:
# x is disconnected because the elements of x are not used # x is disconnected because the elements of x are not used
return DisconnectedType()(), gz return DisconnectedType()(), gz
...@@ -1863,10 +1936,14 @@ class Identity(UnaryScalarOp): ...@@ -1863,10 +1936,14 @@ class Identity(UnaryScalarOp):
def impl(self, input): def impl(self, input):
return input return input
def c_code(self, node, name, (x, ), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(x,) = inputs
(z,) = outputs
return "%(z)s = %(x)s;" % locals() return "%(z)s = %(x)s;" % locals()
def grad(self, (x, ), (gz, )): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
if x.type in continuous_types: if x.type in continuous_types:
return gz, return gz,
else: else:
...@@ -1889,10 +1966,14 @@ class Cast(UnaryScalarOp): ...@@ -1889,10 +1966,14 @@ class Cast(UnaryScalarOp):
def impl(self, input): def impl(self, input):
return self.ctor(input) return self.ctor(input)
def c_code(self, node, name, (x, ), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(x,) = inputs
(z,) = outputs
return "%s = (%s)%s;" % (z, node.outputs[0].type.dtype_specs()[1], x) return "%s = (%s)%s;" % (z, node.outputs[0].type.dtype_specs()[1], x)
def grad(self, (x, ), (gz, )): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
if self.o_type in continuous_types: if self.o_type in continuous_types:
return [gz] return [gz]
else: else:
...@@ -1962,7 +2043,9 @@ class Abs(UnaryScalarOp): ...@@ -1962,7 +2043,9 @@ class Abs(UnaryScalarOp):
def impl(self, x): def impl(self, x):
return numpy.abs(x) return numpy.abs(x)
def grad(self, (x, ), (gz, )): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
if self(x).type in discrete_types: if self(x).type in discrete_types:
if x.type in discrete_types: if x.type in discrete_types:
return [x.zeros_like(dtype=theano.config.floatX)] return [x.zeros_like(dtype=theano.config.floatX)]
...@@ -1971,7 +2054,9 @@ class Abs(UnaryScalarOp): ...@@ -1971,7 +2054,9 @@ class Abs(UnaryScalarOp):
return gz * x / abs(x), # formula works for complex and real return gz * x / abs(x), # formula works for complex and real
def c_code(self, node, name, (x, ), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(x,) = inputs
(z,) = outputs
type = node.inputs[0].type type = node.inputs[0].type
if type in int_types: if type in int_types:
return "%(z)s = abs(%(x)s);" % locals() return "%(z)s = abs(%(x)s);" % locals()
...@@ -1988,8 +2073,9 @@ class Sgn(UnaryScalarOp): ...@@ -1988,8 +2073,9 @@ class Sgn(UnaryScalarOp):
# casting to output type is handled by filter # casting to output type is handled by filter
return numpy.sign(x) return numpy.sign(x)
def grad(self, (x, ), (gz, )): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
rval = x.zeros_like() rval = x.zeros_like()
if rval.type.dtype in discrete_types: if rval.type.dtype in discrete_types:
...@@ -1997,9 +2083,11 @@ class Sgn(UnaryScalarOp): ...@@ -1997,9 +2083,11 @@ class Sgn(UnaryScalarOp):
return [rval] return [rval]
def c_code(self, node, name, (x, ), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
# casting is done by compiler # casting is done by compiler
# TODO: use copysign # TODO: use copysign
(x,) = inputs
(z,) = outputs
type = node.inputs[0].type type = node.inputs[0].type
if type in float_types: if type in float_types:
return "%(z)s = (%(x)s >= 0) ? (%(x)s == 0) ? 0.0 : 1.0 : -1.0;" % locals() return "%(z)s = (%(x)s >= 0) ? (%(x)s == 0) ? 0.0 : 1.0 : -1.0;" % locals()
...@@ -2020,7 +2108,9 @@ class Ceil(UnaryScalarOp): ...@@ -2020,7 +2108,9 @@ class Ceil(UnaryScalarOp):
def impl(self, x): def impl(self, x):
return numpy.ceil(x) return numpy.ceil(x)
def grad(self, (x,), (gz,)): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
rval = x.zeros_like() rval = x.zeros_like()
if rval.type.dtype in discrete_types: if rval.type.dtype in discrete_types:
...@@ -2028,7 +2118,9 @@ class Ceil(UnaryScalarOp): ...@@ -2028,7 +2118,9 @@ class Ceil(UnaryScalarOp):
return [rval] return [rval]
def c_code(self, node, name, (x,), (z,), sub): def c_code(self, node, name, inputs, outputs, sub):
(x,) = inputs
(z,) = outputs
return "%(z)s = ceil(%(x)s);" % locals() return "%(z)s = ceil(%(x)s);" % locals()
ceil = Ceil(same_out_nocomplex, name='ceil') ceil = Ceil(same_out_nocomplex, name='ceil')
...@@ -2037,7 +2129,9 @@ class Floor(UnaryScalarOp): ...@@ -2037,7 +2129,9 @@ class Floor(UnaryScalarOp):
def impl(self, x): def impl(self, x):
return numpy.floor(x) return numpy.floor(x)
def grad(self, (x,), (gz,)): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
rval = x.zeros_like() rval = x.zeros_like()
if rval.type.dtype in discrete_types: if rval.type.dtype in discrete_types:
...@@ -2045,7 +2139,9 @@ class Floor(UnaryScalarOp): ...@@ -2045,7 +2139,9 @@ class Floor(UnaryScalarOp):
return [rval] return [rval]
def c_code(self, node, name, (x,), (z,), sub): def c_code(self, node, name, inputs, outputs, sub):
(x,) = inputs
(z,) = outputs
return "%(z)s = floor(%(x)s);" % locals() return "%(z)s = floor(%(x)s);" % locals()
floor = Floor(same_out_nocomplex, name='floor') floor = Floor(same_out_nocomplex, name='floor')
...@@ -2054,10 +2150,14 @@ class Trunc(UnaryScalarOp): ...@@ -2054,10 +2150,14 @@ class Trunc(UnaryScalarOp):
def impl(self, x): def impl(self, x):
return numpy.trunc(x) return numpy.trunc(x)
def grad(self, (x,), (gz,)): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
return [x.zeros_like().astype(theano.config.floatX)] return [x.zeros_like().astype(theano.config.floatX)]
def c_code(self, node, name, (x,), (z,), sub): def c_code(self, node, name, inputs, outputs, sub):
(x,) = inputs
(z,) = outputs
return "%(z)s = %(x)s >= 0? floor(%(x)s): -floor(-%(x)s);" % locals() return "%(z)s = %(x)s >= 0? floor(%(x)s): -floor(-%(x)s);" % locals()
trunc = Trunc(same_out_nocomplex, name='trunc') trunc = Trunc(same_out_nocomplex, name='trunc')
...@@ -2072,7 +2172,9 @@ class RoundHalfToEven(UnaryScalarOp): ...@@ -2072,7 +2172,9 @@ class RoundHalfToEven(UnaryScalarOp):
def impl(self, x): def impl(self, x):
return numpy.round(x) return numpy.round(x)
def grad(self, (x,), (gz,)): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
rval = x.zeros_like() rval = x.zeros_like()
if rval.type.dtype in discrete_types: if rval.type.dtype in discrete_types:
...@@ -2080,7 +2182,9 @@ class RoundHalfToEven(UnaryScalarOp): ...@@ -2080,7 +2182,9 @@ class RoundHalfToEven(UnaryScalarOp):
return [rval] return [rval]
def c_code___(self, node, name, (x, ), (z, ), sub): def c_code___(self, node, name, inputs, outputs, sub):
(x,) = inputs
(z,) = outputs
typ = node.outputs[0].type.dtype typ = node.outputs[0].type.dtype
if not typ in ['float32', 'float64']: if not typ in ['float32', 'float64']:
Exception("The output should be float32 or float64") Exception("The output should be float32 or float64")
...@@ -2164,7 +2268,9 @@ class RoundHalfAwayFromZero(UnaryScalarOp): ...@@ -2164,7 +2268,9 @@ class RoundHalfAwayFromZero(UnaryScalarOp):
def impl(self, x): def impl(self, x):
return round_half_away_from_zero_vec(x) return round_half_away_from_zero_vec(x)
def grad(self, (x,), (gz,)): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
rval = x.zeros_like() rval = x.zeros_like()
if rval.type.dtype in discrete_types: if rval.type.dtype in discrete_types:
...@@ -2172,7 +2278,9 @@ class RoundHalfAwayFromZero(UnaryScalarOp): ...@@ -2172,7 +2278,9 @@ class RoundHalfAwayFromZero(UnaryScalarOp):
return [rval] return [rval]
def c_code(self, node, name, (x, ), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(x,) = inputs
(z,) = outputs
if node.outputs[0].type.dtype in ['float32', 'float64']: if node.outputs[0].type.dtype in ['float32', 'float64']:
return "%(z)s = round(%(x)s);" % locals() return "%(z)s = round(%(x)s);" % locals()
else: else:
...@@ -2184,7 +2292,9 @@ class Neg(UnaryScalarOp): ...@@ -2184,7 +2292,9 @@ class Neg(UnaryScalarOp):
def impl(self, x): def impl(self, x):
return -x return -x
def grad(self, (x,), (gz,)): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
if self(x).type in discrete_types: if self(x).type in discrete_types:
if x.type in discrete_types: if x.type in discrete_types:
return [x.zeros_like(dtype=theano.config.floatX)] return [x.zeros_like(dtype=theano.config.floatX)]
...@@ -2193,7 +2303,9 @@ class Neg(UnaryScalarOp): ...@@ -2193,7 +2303,9 @@ class Neg(UnaryScalarOp):
return -gz, return -gz,
def c_code(self, node, name, (x,), (z,), sub): def c_code(self, node, name, inputs, outputs, sub):
(x,) = inputs
(z,) = outputs
return "%(z)s = -%(x)s;" % locals() return "%(z)s = -%(x)s;" % locals()
neg = Neg(same_out, name='neg') neg = Neg(same_out, name='neg')
...@@ -2212,7 +2324,9 @@ class Inv(UnaryScalarOp): ...@@ -2212,7 +2324,9 @@ class Inv(UnaryScalarOp):
def impl(self, x): def impl(self, x):
return numpy.float32(1.0) / x return numpy.float32(1.0) / x
def grad(self, (x,), (gz,)): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
if x.type in complex_types: if x.type in complex_types:
raise NotImplementedError() raise NotImplementedError()
if self(x).type in discrete_types: if self(x).type in discrete_types:
...@@ -2223,7 +2337,9 @@ class Inv(UnaryScalarOp): ...@@ -2223,7 +2337,9 @@ class Inv(UnaryScalarOp):
return -gz / (x * x), return -gz / (x * x),
def c_code(self, node, name, (x,), (z,), sub): def c_code(self, node, name, inputs, outputs, sub):
(x,) = inputs
(z,) = outputs
if node.inputs[0].type in complex_types: if node.inputs[0].type in complex_types:
raise NotImplementedError() raise NotImplementedError()
return "%(z)s = 1.0 / %(x)s;" % locals() return "%(z)s = 1.0 / %(x)s;" % locals()
...@@ -2243,7 +2359,9 @@ class Log(UnaryScalarOp): ...@@ -2243,7 +2359,9 @@ class Log(UnaryScalarOp):
return numpy.log(x, sig='f') return numpy.log(x, sig='f')
return numpy.log(x) return numpy.log(x)
def grad(self, (x,), (gz,)): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
if x.type in complex_types: if x.type in complex_types:
raise NotImplementedError() raise NotImplementedError()
if self(x).type in discrete_types: if self(x).type in discrete_types:
...@@ -2254,10 +2372,12 @@ class Log(UnaryScalarOp): ...@@ -2254,10 +2372,12 @@ class Log(UnaryScalarOp):
return gz / x, return gz / x,
def c_code(self, node, name, (x,), (z,), sub): def c_code(self, node, name, inputs, outputs, sub):
# todo: the version using log2 seems to be very slightly faster # todo: the version using log2 seems to be very slightly faster
# on some machines for some reason, check if it's worth switching # on some machines for some reason, check if it's worth switching
# return "%(z)s = log2(%(x)s) * 0.69314718055994529;" % locals() # return "%(z)s = log2(%(x)s) * 0.69314718055994529;" % locals()
(x,) = inputs
(z,) = outputs
if node.inputs[0].type in complex_types: if node.inputs[0].type in complex_types:
raise NotImplementedError('type not supported', type) raise NotImplementedError('type not supported', type)
return "%(z)s = log(%(x)s);" % locals() return "%(z)s = log(%(x)s);" % locals()
...@@ -2277,7 +2397,9 @@ class Log2(UnaryScalarOp): ...@@ -2277,7 +2397,9 @@ class Log2(UnaryScalarOp):
return numpy.log2(x, sig='f') return numpy.log2(x, sig='f')
return numpy.log2(x) return numpy.log2(x)
def grad(self, (x,), (gz,)): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
if x.type in complex_types: if x.type in complex_types:
raise NotImplementedError() raise NotImplementedError()
if self(x).type in discrete_types: if self(x).type in discrete_types:
...@@ -2288,7 +2410,9 @@ class Log2(UnaryScalarOp): ...@@ -2288,7 +2410,9 @@ class Log2(UnaryScalarOp):
return gz / (x * math.log(2.0)), return gz / (x * math.log(2.0)),
def c_code(self, node, name, (x, ), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(x,) = inputs
(z,) = outputs
if node.inputs[0].type in complex_types: if node.inputs[0].type in complex_types:
raise NotImplementedError('type not supported', type) raise NotImplementedError('type not supported', type)
return "%(z)s = log2(%(x)s);" % locals() return "%(z)s = log2(%(x)s);" % locals()
...@@ -2308,7 +2432,9 @@ class Log10(UnaryScalarOp): ...@@ -2308,7 +2432,9 @@ class Log10(UnaryScalarOp):
return numpy.log10(x, sig='f') return numpy.log10(x, sig='f')
return numpy.log10(x) return numpy.log10(x)
def grad(self, (x,), (gz,)): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
if x.type in complex_types: if x.type in complex_types:
raise NotImplementedError() raise NotImplementedError()
if self(x).type in discrete_types: if self(x).type in discrete_types:
...@@ -2319,7 +2445,9 @@ class Log10(UnaryScalarOp): ...@@ -2319,7 +2445,9 @@ class Log10(UnaryScalarOp):
return gz / (x * numpy.log(10.0)), return gz / (x * numpy.log(10.0)),
def c_code(self, node, name, (x, ), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(x,) = inputs
(z,) = outputs
if node.inputs[0].type in complex_types: if node.inputs[0].type in complex_types:
raise NotImplementedError('type not supported', type) raise NotImplementedError('type not supported', type)
return "%(z)s = log10(%(x)s);" % locals() return "%(z)s = log10(%(x)s);" % locals()
...@@ -2336,7 +2464,9 @@ class Log1p(UnaryScalarOp): ...@@ -2336,7 +2464,9 @@ class Log1p(UnaryScalarOp):
return numpy.log1p(x, sig='f') return numpy.log1p(x, sig='f')
return numpy.log1p(x) return numpy.log1p(x)
def grad(self, (x,), (gz,)): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
if gz.type in complex_types: if gz.type in complex_types:
raise NotImplementedError() raise NotImplementedError()
if self(x).type in discrete_types: if self(x).type in discrete_types:
...@@ -2347,7 +2477,9 @@ class Log1p(UnaryScalarOp): ...@@ -2347,7 +2477,9 @@ class Log1p(UnaryScalarOp):
return [gz / (1 + x)] return [gz / (1 + x)]
def c_code(self, node, name, (x, ), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(x,) = inputs
(z,) = outputs
if node.inputs[0].type in complex_types: if node.inputs[0].type in complex_types:
raise NotImplementedError('type not supported', type) raise NotImplementedError('type not supported', type)
return "%(z)s = log1p(%(x)s);" % locals() return "%(z)s = log1p(%(x)s);" % locals()
...@@ -2366,7 +2498,9 @@ class Exp(UnaryScalarOp): ...@@ -2366,7 +2498,9 @@ class Exp(UnaryScalarOp):
return numpy.exp(x, sig='f') return numpy.exp(x, sig='f')
return numpy.exp(x) return numpy.exp(x)
def grad(self, (x, ), (gz, )): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
if x.type in complex_types: if x.type in complex_types:
raise NotImplementedError() raise NotImplementedError()
if self(x).type in discrete_types: if self(x).type in discrete_types:
...@@ -2377,7 +2511,9 @@ class Exp(UnaryScalarOp): ...@@ -2377,7 +2511,9 @@ class Exp(UnaryScalarOp):
return gz * exp(x), return gz * exp(x),
def c_code(self, node, name, (x, ), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(x,) = inputs
(z,) = outputs
if node.inputs[0].type in complex_types: if node.inputs[0].type in complex_types:
raise NotImplementedError('type not supported', type) raise NotImplementedError('type not supported', type)
return "%(z)s = exp(%(x)s);" % locals() return "%(z)s = exp(%(x)s);" % locals()
...@@ -2393,7 +2529,9 @@ class Exp2(UnaryScalarOp): ...@@ -2393,7 +2529,9 @@ class Exp2(UnaryScalarOp):
return numpy.exp2(x, sig='f') return numpy.exp2(x, sig='f')
return numpy.exp2(x) return numpy.exp2(x)
def grad(self, (x, ), (gz, )): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
if x.type in complex_types: if x.type in complex_types:
raise NotImplementedError() raise NotImplementedError()
if self(x).type in discrete_types: if self(x).type in discrete_types:
...@@ -2404,7 +2542,9 @@ class Exp2(UnaryScalarOp): ...@@ -2404,7 +2542,9 @@ class Exp2(UnaryScalarOp):
return gz * exp2(x) * log(numpy.cast[x.type](2)), return gz * exp2(x) * log(numpy.cast[x.type](2)),
def c_code(self, node, name, (x, ), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(x,) = inputs
(z,) = outputs
if node.inputs[0].type in complex_types: if node.inputs[0].type in complex_types:
raise NotImplementedError('type not supported', type) raise NotImplementedError('type not supported', type)
return "%(z)s = exp2(%(x)s);" % locals() return "%(z)s = exp2(%(x)s);" % locals()
...@@ -2420,7 +2560,9 @@ class Expm1(UnaryScalarOp): ...@@ -2420,7 +2560,9 @@ class Expm1(UnaryScalarOp):
return numpy.expm1(x, sig='f') return numpy.expm1(x, sig='f')
return numpy.expm1(x) return numpy.expm1(x)
def grad(self, (x, ), (gz, )): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
if x.type in complex_types: if x.type in complex_types:
raise NotImplementedError() raise NotImplementedError()
if self(x).type in discrete_types: if self(x).type in discrete_types:
...@@ -2431,7 +2573,9 @@ class Expm1(UnaryScalarOp): ...@@ -2431,7 +2573,9 @@ class Expm1(UnaryScalarOp):
return gz * exp(x), return gz * exp(x),
def c_code(self, node, name, (x, ), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(x,) = inputs
(z,) = outputs
if node.inputs[0].type in complex_types: if node.inputs[0].type in complex_types:
raise NotImplementedError('type not supported', type) raise NotImplementedError('type not supported', type)
return "%(z)s = expm1(%(x)s);" % locals() return "%(z)s = expm1(%(x)s);" % locals()
...@@ -2445,7 +2589,9 @@ class Sqr(UnaryScalarOp): ...@@ -2445,7 +2589,9 @@ class Sqr(UnaryScalarOp):
def impl(self, x): def impl(self, x):
return x * x return x * x
def grad(self, (x, ), (gz, )): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
if gz.type in complex_types: if gz.type in complex_types:
raise NotImplementedError() raise NotImplementedError()
if self(x).type in discrete_types: if self(x).type in discrete_types:
...@@ -2456,7 +2602,9 @@ class Sqr(UnaryScalarOp): ...@@ -2456,7 +2602,9 @@ class Sqr(UnaryScalarOp):
return gz * x * 2, return gz * x * 2,
def c_code(self, node, name, (x, ), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(x,) = inputs
(z,) = outputs
return "%(z)s = %(x)s * %(x)s;" % locals() return "%(z)s = %(x)s * %(x)s;" % locals()
sqr = Sqr(same_out, name='sqr') sqr = Sqr(same_out, name='sqr')
...@@ -2470,7 +2618,9 @@ class Sqrt(UnaryScalarOp): ...@@ -2470,7 +2618,9 @@ class Sqrt(UnaryScalarOp):
return numpy.sqrt(x, sig='f') return numpy.sqrt(x, sig='f')
return numpy.sqrt(x) return numpy.sqrt(x)
def grad(self, (x,), (gz,)): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
if gz.type in complex_types: if gz.type in complex_types:
raise NotImplementedError() raise NotImplementedError()
if self(x).type in discrete_types: if self(x).type in discrete_types:
...@@ -2481,7 +2631,9 @@ class Sqrt(UnaryScalarOp): ...@@ -2481,7 +2631,9 @@ class Sqrt(UnaryScalarOp):
return (gz * 0.5) / sqrt(x), return (gz * 0.5) / sqrt(x),
def c_code(self, node, name, (x,), (z,), sub): def c_code(self, node, name, inputs, outputs, sub):
(x,) = inputs
(z,) = outputs
if node.inputs[0].type in complex_types: if node.inputs[0].type in complex_types:
raise NotImplementedError('type not supported', type) raise NotImplementedError('type not supported', type)
return "%(z)s = sqrt(%(x)s);" % locals() return "%(z)s = sqrt(%(x)s);" % locals()
...@@ -2497,7 +2649,9 @@ class Deg2Rad(UnaryScalarOp): ...@@ -2497,7 +2649,9 @@ class Deg2Rad(UnaryScalarOp):
return numpy.deg2rad(x, sig='f') return numpy.deg2rad(x, sig='f')
return numpy.deg2rad(x) return numpy.deg2rad(x)
def grad(self, (x,), (gz,)): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
if gz.type in complex_types: if gz.type in complex_types:
raise NotImplementedError() raise NotImplementedError()
if self(x).type in discrete_types: if self(x).type in discrete_types:
...@@ -2508,7 +2662,9 @@ class Deg2Rad(UnaryScalarOp): ...@@ -2508,7 +2662,9 @@ class Deg2Rad(UnaryScalarOp):
return gz * numpy.asarray(numpy.pi / 180, gz.type), return gz * numpy.asarray(numpy.pi / 180, gz.type),
def c_code(self, node, name, (x,), (z,), sub): def c_code(self, node, name, inputs, outputs, sub):
(x,) = inputs
(z,) = outputs
if node.inputs[0].type in complex_types: if node.inputs[0].type in complex_types:
raise NotImplementedError('type not supported', type) raise NotImplementedError('type not supported', type)
return "%(z)s = %(x)s * (M_PI / 180.0);" % locals() return "%(z)s = %(x)s * (M_PI / 180.0);" % locals()
...@@ -2524,7 +2680,9 @@ class Rad2Deg(UnaryScalarOp): ...@@ -2524,7 +2680,9 @@ class Rad2Deg(UnaryScalarOp):
return numpy.rad2deg(x, sig='f') return numpy.rad2deg(x, sig='f')
return numpy.rad2deg(x) return numpy.rad2deg(x)
def grad(self, (x,), (gz,)): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
if gz.type in complex_types: if gz.type in complex_types:
raise NotImplementedError() raise NotImplementedError()
if self(x).type in discrete_types: if self(x).type in discrete_types:
...@@ -2535,7 +2693,9 @@ class Rad2Deg(UnaryScalarOp): ...@@ -2535,7 +2693,9 @@ class Rad2Deg(UnaryScalarOp):
return gz * numpy.asarray(180. / numpy.pi, gz.type), return gz * numpy.asarray(180. / numpy.pi, gz.type),
def c_code(self, node, name, (x,), (z,), sub): def c_code(self, node, name, inputs, outputs, sub):
(x,) = inputs
(z,) = outputs
if node.inputs[0].type in complex_types: if node.inputs[0].type in complex_types:
raise NotImplementedError('type not supported', type) raise NotImplementedError('type not supported', type)
return "%(z)s = %(x)s * (180.0 / M_PI);" % locals() return "%(z)s = %(x)s * (180.0 / M_PI);" % locals()
...@@ -2554,7 +2714,9 @@ class Cos(UnaryScalarOp): ...@@ -2554,7 +2714,9 @@ class Cos(UnaryScalarOp):
return numpy.cos(x, sig='f') return numpy.cos(x, sig='f')
return numpy.cos(x) return numpy.cos(x)
def grad(self, (x, ), (gz, )): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
if gz.type in complex_types: if gz.type in complex_types:
raise NotImplementedError() raise NotImplementedError()
if self(x).type in discrete_types: if self(x).type in discrete_types:
...@@ -2565,7 +2727,9 @@ class Cos(UnaryScalarOp): ...@@ -2565,7 +2727,9 @@ class Cos(UnaryScalarOp):
return -gz * sin(x), return -gz * sin(x),
def c_code(self, node, name, (x, ), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(x,) = inputs
(z,) = outputs
if node.inputs[0].type in complex_types: if node.inputs[0].type in complex_types:
raise NotImplementedError('type not supported', type) raise NotImplementedError('type not supported', type)
return "%(z)s = cos(%(x)s);" % locals() return "%(z)s = cos(%(x)s);" % locals()
...@@ -2581,7 +2745,9 @@ class ArcCos(UnaryScalarOp): ...@@ -2581,7 +2745,9 @@ class ArcCos(UnaryScalarOp):
return numpy.arccos(x, sig='f') return numpy.arccos(x, sig='f')
return numpy.arccos(x) return numpy.arccos(x)
def grad(self, (x,), (gz,)): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
if gz.type in complex_types: if gz.type in complex_types:
raise NotImplementedError() raise NotImplementedError()
if self(x).type in discrete_types: if self(x).type in discrete_types:
...@@ -2592,7 +2758,9 @@ class ArcCos(UnaryScalarOp): ...@@ -2592,7 +2758,9 @@ class ArcCos(UnaryScalarOp):
return - gz / sqrt(numpy.cast[x.type](1) - sqr(x)), return - gz / sqrt(numpy.cast[x.type](1) - sqr(x)),
def c_code(self, node, name, (x,), (z,), sub): def c_code(self, node, name, inputs, outputs, sub):
(x,) = inputs
(z,) = outputs
if node.inputs[0].type in complex_types: if node.inputs[0].type in complex_types:
raise NotImplementedError('type not supported', type) raise NotImplementedError('type not supported', type)
return "%(z)s = acos(%(x)s);" % locals() return "%(z)s = acos(%(x)s);" % locals()
...@@ -2611,7 +2779,9 @@ class Sin(UnaryScalarOp): ...@@ -2611,7 +2779,9 @@ class Sin(UnaryScalarOp):
return numpy.sin(x, sig='f') return numpy.sin(x, sig='f')
return numpy.sin(x) return numpy.sin(x)
def grad(self, (x, ), (gz, )): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
if x.type in complex_types: if x.type in complex_types:
raise NotImplementedError() raise NotImplementedError()
if self(x).type in discrete_types: if self(x).type in discrete_types:
...@@ -2622,7 +2792,9 @@ class Sin(UnaryScalarOp): ...@@ -2622,7 +2792,9 @@ class Sin(UnaryScalarOp):
return gz * cos(x), return gz * cos(x),
def c_code(self, node, name, (x, ), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(x,) = inputs
(z,) = outputs
if node.inputs[0].type in complex_types: if node.inputs[0].type in complex_types:
raise NotImplementedError('type not supported', type) raise NotImplementedError('type not supported', type)
return "%(z)s = sin(%(x)s);" % locals() return "%(z)s = sin(%(x)s);" % locals()
...@@ -2638,7 +2810,9 @@ class ArcSin(UnaryScalarOp): ...@@ -2638,7 +2810,9 @@ class ArcSin(UnaryScalarOp):
return numpy.arcsin(x, sig='f') return numpy.arcsin(x, sig='f')
return numpy.arcsin(x) return numpy.arcsin(x)
def grad(self, (x,), (gz,)): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
if gz.type in complex_types: if gz.type in complex_types:
raise NotImplementedError() raise NotImplementedError()
if self(x).type in discrete_types: if self(x).type in discrete_types:
...@@ -2649,7 +2823,9 @@ class ArcSin(UnaryScalarOp): ...@@ -2649,7 +2823,9 @@ class ArcSin(UnaryScalarOp):
return gz / sqrt(numpy.cast[x.type](1) - sqr(x)), return gz / sqrt(numpy.cast[x.type](1) - sqr(x)),
def c_code(self, node, name, (x,), (z,), sub): def c_code(self, node, name, inputs, outputs, sub):
(x,) = inputs
(z,) = outputs
if node.inputs[0].type in complex_types: if node.inputs[0].type in complex_types:
raise NotImplementedError('type not supported', type) raise NotImplementedError('type not supported', type)
return "%(z)s = asin(%(x)s);" % locals() return "%(z)s = asin(%(x)s);" % locals()
...@@ -2665,7 +2841,9 @@ class Tan(UnaryScalarOp): ...@@ -2665,7 +2841,9 @@ class Tan(UnaryScalarOp):
return numpy.tan(x, sig='f') return numpy.tan(x, sig='f')
return numpy.tan(x) return numpy.tan(x)
def grad(self, (x,), (gz,)): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
if x.type in complex_types: if x.type in complex_types:
raise NotImplementedError() raise NotImplementedError()
if self(x).type in discrete_types: if self(x).type in discrete_types:
...@@ -2676,7 +2854,9 @@ class Tan(UnaryScalarOp): ...@@ -2676,7 +2854,9 @@ class Tan(UnaryScalarOp):
return gz / sqr(cos(x)), return gz / sqr(cos(x)),
def c_code(self, node, name, (x, ), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(x,) = inputs
(z,) = outputs
if node.inputs[0].type in complex_types: if node.inputs[0].type in complex_types:
raise NotImplementedError('type not supported', type) raise NotImplementedError('type not supported', type)
return "%(z)s = tan(%(x)s);" % locals() return "%(z)s = tan(%(x)s);" % locals()
...@@ -2692,7 +2872,9 @@ class ArcTan(UnaryScalarOp): ...@@ -2692,7 +2872,9 @@ class ArcTan(UnaryScalarOp):
return numpy.arctan(x, sig='f') return numpy.arctan(x, sig='f')
return numpy.arctan(x) return numpy.arctan(x)
def grad(self, (x,), (gz,)): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
if gz.type in complex_types: if gz.type in complex_types:
raise NotImplementedError() raise NotImplementedError()
if self(x).type in discrete_types: if self(x).type in discrete_types:
...@@ -2703,7 +2885,9 @@ class ArcTan(UnaryScalarOp): ...@@ -2703,7 +2885,9 @@ class ArcTan(UnaryScalarOp):
return gz / (numpy.cast[x.type](1) + sqr(x)), return gz / (numpy.cast[x.type](1) + sqr(x)),
def c_code(self, node, name, (x,), (z,), sub): def c_code(self, node, name, inputs, outputs, sub):
(x,) = inputs
(z,) = outputs
if node.inputs[0].type in complex_types: if node.inputs[0].type in complex_types:
raise NotImplementedError('type not supported', type) raise NotImplementedError('type not supported', type)
return "%(z)s = atan(%(x)s);" % locals() return "%(z)s = atan(%(x)s);" % locals()
...@@ -2721,7 +2905,9 @@ class ArcTan2(BinaryScalarOp): ...@@ -2721,7 +2905,9 @@ class ArcTan2(BinaryScalarOp):
return numpy.arctan2(y, x, sig='f') return numpy.arctan2(y, x, sig='f')
return numpy.arctan2(y, x) return numpy.arctan2(y, x)
def grad(self, (y, x), (gz,)): def grad(self, inputs, gout):
(y, x) = inputs
(gz,) = gout
if gz.type in complex_types: if gz.type in complex_types:
raise NotImplementedError() raise NotImplementedError()
else: else:
...@@ -2741,7 +2927,9 @@ class ArcTan2(BinaryScalarOp): ...@@ -2741,7 +2927,9 @@ class ArcTan2(BinaryScalarOp):
return [gz * x / (sqr(x) + sqr(y)), return [gz * x / (sqr(x) + sqr(y)),
gz * neg(y) / (sqr(x) + sqr(y))] gz * neg(y) / (sqr(x) + sqr(y))]
def c_code(self, node, name, (y, x), (z,), sub): def c_code(self, node, name, inputs, outputs, sub):
(y, x) = inputs
(z,) = outputs
if (node.inputs[0].type in complex_types or if (node.inputs[0].type in complex_types or
node.inputs[1].type in complex_types): node.inputs[1].type in complex_types):
raise NotImplementedError('type not supported', type) raise NotImplementedError('type not supported', type)
...@@ -2761,7 +2949,9 @@ class Cosh(UnaryScalarOp): ...@@ -2761,7 +2949,9 @@ class Cosh(UnaryScalarOp):
return numpy.cosh(x, sig='f') return numpy.cosh(x, sig='f')
return numpy.cosh(x) return numpy.cosh(x)
def grad(self, (x, ), (gz, )): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
if x.type in complex_types: if x.type in complex_types:
raise NotImplementedError() raise NotImplementedError()
if self(x).type in discrete_types: if self(x).type in discrete_types:
...@@ -2772,7 +2962,9 @@ class Cosh(UnaryScalarOp): ...@@ -2772,7 +2962,9 @@ class Cosh(UnaryScalarOp):
return gz * sinh(x), return gz * sinh(x),
def c_code(self, node, name, (x, ), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(x,) = inputs
(z,) = outputs
if node.inputs[0].type in complex_types: if node.inputs[0].type in complex_types:
raise NotImplementedError('type not supported', type) raise NotImplementedError('type not supported', type)
return "%(z)s = cosh(%(x)s);" % locals() return "%(z)s = cosh(%(x)s);" % locals()
...@@ -2788,7 +2980,9 @@ class ArcCosh(UnaryScalarOp): ...@@ -2788,7 +2980,9 @@ class ArcCosh(UnaryScalarOp):
return numpy.arccosh(x, sig='f') return numpy.arccosh(x, sig='f')
return numpy.arccosh(x) return numpy.arccosh(x)
def grad(self, (x, ), (gz, )): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
if x.type in complex_types: if x.type in complex_types:
raise NotImplementedError() raise NotImplementedError()
if self(x).type in discrete_types: if self(x).type in discrete_types:
...@@ -2799,7 +2993,9 @@ class ArcCosh(UnaryScalarOp): ...@@ -2799,7 +2993,9 @@ class ArcCosh(UnaryScalarOp):
return gz / sqrt(sqr(x) - numpy.cast[x.type](1)), return gz / sqrt(sqr(x) - numpy.cast[x.type](1)),
def c_code(self, node, name, (x, ), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(x,) = inputs
(z,) = outputs
if node.inputs[0].type in complex_types: if node.inputs[0].type in complex_types:
raise NotImplementedError('type not supported', type) raise NotImplementedError('type not supported', type)
return "%(z)s = acosh(%(x)s);" % locals() return "%(z)s = acosh(%(x)s);" % locals()
...@@ -2818,7 +3014,9 @@ class Sinh(UnaryScalarOp): ...@@ -2818,7 +3014,9 @@ class Sinh(UnaryScalarOp):
return numpy.sinh(x, sig='f') return numpy.sinh(x, sig='f')
return numpy.sinh(x) return numpy.sinh(x)
def grad(self, (x, ), (gz, )): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
if x.type in complex_types: if x.type in complex_types:
raise NotImplementedError() raise NotImplementedError()
if self(x).type in discrete_types: if self(x).type in discrete_types:
...@@ -2829,7 +3027,9 @@ class Sinh(UnaryScalarOp): ...@@ -2829,7 +3027,9 @@ class Sinh(UnaryScalarOp):
return gz * cosh(x), return gz * cosh(x),
def c_code(self, node, name, (x, ), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(x,) = inputs
(z,) = outputs
if node.inputs[0].type in complex_types: if node.inputs[0].type in complex_types:
raise NotImplementedError('type not supported', type) raise NotImplementedError('type not supported', type)
return "%(z)s = sinh(%(x)s);" % locals() return "%(z)s = sinh(%(x)s);" % locals()
...@@ -2845,7 +3045,9 @@ class ArcSinh(UnaryScalarOp): ...@@ -2845,7 +3045,9 @@ class ArcSinh(UnaryScalarOp):
return numpy.arcsinh(x, sig='f') return numpy.arcsinh(x, sig='f')
return numpy.arcsinh(x) return numpy.arcsinh(x)
def grad(self, (x, ), (gz, )): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
if x.type in complex_types: if x.type in complex_types:
raise NotImplementedError() raise NotImplementedError()
if self(x).type in discrete_types: if self(x).type in discrete_types:
...@@ -2856,7 +3058,9 @@ class ArcSinh(UnaryScalarOp): ...@@ -2856,7 +3058,9 @@ class ArcSinh(UnaryScalarOp):
return gz / sqrt(sqr(x) + numpy.cast[x.type](1)), return gz / sqrt(sqr(x) + numpy.cast[x.type](1)),
def c_code(self, node, name, (x, ), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(x,) = inputs
(z,) = outputs
if node.inputs[0].type in complex_types: if node.inputs[0].type in complex_types:
raise NotImplementedError('type not supported', type) raise NotImplementedError('type not supported', type)
return "%(z)s = asinh(%(x)s);" % locals() return "%(z)s = asinh(%(x)s);" % locals()
...@@ -2876,7 +3080,9 @@ class Tanh(UnaryScalarOp): ...@@ -2876,7 +3080,9 @@ class Tanh(UnaryScalarOp):
return numpy.tanh(x, sig='f') return numpy.tanh(x, sig='f')
return numpy.tanh(x) return numpy.tanh(x)
def grad(self, (x, ), (gz, )): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
if x.type in complex_types: if x.type in complex_types:
raise NotImplementedError() raise NotImplementedError()
if self(x).type in discrete_types: if self(x).type in discrete_types:
...@@ -2887,7 +3093,9 @@ class Tanh(UnaryScalarOp): ...@@ -2887,7 +3093,9 @@ class Tanh(UnaryScalarOp):
return gz * (1 - sqr(tanh(x))), return gz * (1 - sqr(tanh(x))),
def c_code(self, node, name, (x, ), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(x,) = inputs
(z,) = outputs
if node.inputs[0].type in complex_types: if node.inputs[0].type in complex_types:
raise NotImplementedError('type not supported', type) raise NotImplementedError('type not supported', type)
return "%(z)s = tanh(%(x)s);" % locals() return "%(z)s = tanh(%(x)s);" % locals()
...@@ -2903,7 +3111,9 @@ class ArcTanh(UnaryScalarOp): ...@@ -2903,7 +3111,9 @@ class ArcTanh(UnaryScalarOp):
return numpy.arctanh(x, sig='f') return numpy.arctanh(x, sig='f')
return numpy.arctanh(x) return numpy.arctanh(x)
def grad(self, (x, ), (gz, )): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
if x.type in complex_types: if x.type in complex_types:
raise NotImplementedError() raise NotImplementedError()
if self(x).type in discrete_types: if self(x).type in discrete_types:
...@@ -2914,7 +3124,9 @@ class ArcTanh(UnaryScalarOp): ...@@ -2914,7 +3124,9 @@ class ArcTanh(UnaryScalarOp):
return gz / (numpy.cast[x.type](1) - sqr(x)), return gz / (numpy.cast[x.type](1) - sqr(x)),
def c_code(self, node, name, (x, ), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(x,) = inputs
(z,) = outputs
if node.inputs[0].type in complex_types: if node.inputs[0].type in complex_types:
raise NotImplementedError('type not supported', type) raise NotImplementedError('type not supported', type)
return "%(z)s = atanh(%(x)s);" % locals() return "%(z)s = atanh(%(x)s);" % locals()
...@@ -2926,7 +3138,9 @@ class Real(UnaryScalarOp): ...@@ -2926,7 +3138,9 @@ class Real(UnaryScalarOp):
def impl(self, x): def impl(self, x):
return numpy.real(x) return numpy.real(x)
def grad(self, (x, ), (gz, )): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
return [complex(gz, 0)] return [complex(gz, 0)]
real = Real(real_out, name='real') real = Real(real_out, name='real')
...@@ -2936,7 +3150,9 @@ class Imag(UnaryScalarOp): ...@@ -2936,7 +3150,9 @@ class Imag(UnaryScalarOp):
def impl(self, x): def impl(self, x):
return numpy.imag(x) return numpy.imag(x)
def grad(self, (x, ), (gz, )): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
if x.type in complex_types: if x.type in complex_types:
return [complex(0, gz)] return [complex(0, gz)]
elif x.type in float_types: elif x.type in float_types:
...@@ -2951,7 +3167,7 @@ class Angle(UnaryScalarOp): ...@@ -2951,7 +3167,7 @@ class Angle(UnaryScalarOp):
def impl(self, x): def impl(self, x):
return numpy.angle(x) return numpy.angle(x)
def grad(self, (c, ), (gtheta, )): def grad(self, inputs, gout):
# y = x.imag # y = x.imag
# r = sqrt(y**2 + x.real**2) # r = sqrt(y**2 + x.real**2)
# g = y/r # g = y/r
...@@ -2962,6 +3178,8 @@ class Angle(UnaryScalarOp): ...@@ -2962,6 +3178,8 @@ class Angle(UnaryScalarOp):
# else: # else:
# theta = -numpy.arcsin(g)+numpy.pi # theta = -numpy.arcsin(g)+numpy.pi
(c,) = inputs
(gtheta,) = gout
x = real(c) x = real(c)
y = imag(c) y = imag(c)
r = abs(c) r = abs(c)
...@@ -2996,7 +3214,9 @@ class Complex(BinaryScalarOp): ...@@ -2996,7 +3214,9 @@ class Complex(BinaryScalarOp):
def impl(self, x, y): def impl(self, x, y):
return numpy.complex(x, y) return numpy.complex(x, y)
def grad(self, (x, y), (gz,)): def grad(self, inputs, gout):
(x, y) = inputs
(gz,) = gout
return [cast(real(gz), x.type.dtype), return [cast(real(gz), x.type.dtype),
cast(imag(gz), y.type.dtype)] cast(imag(gz), y.type.dtype)]
complex = Complex(name='complex') complex = Complex(name='complex')
...@@ -3023,7 +3243,9 @@ class ComplexFromPolar(BinaryScalarOp): ...@@ -3023,7 +3243,9 @@ class ComplexFromPolar(BinaryScalarOp):
else: else:
return numpy.complex128(numpy.complex(x, y)) return numpy.complex128(numpy.complex(x, y))
def grad(self, (r, theta), (gz,)): def grad(self, inputs, gout):
(r, theta) = inputs
(gz,) = gout
gr = gz * complex_from_polar(1, theta) gr = gz * complex_from_polar(1, theta)
gtheta = gz * complex_from_polar(r, -theta) gtheta = gz * complex_from_polar(r, -theta)
return [gr, gtheta] return [gr, gtheta]
......
...@@ -171,7 +171,9 @@ class Gamma(UnaryScalarOp): ...@@ -171,7 +171,9 @@ class Gamma(UnaryScalarOp):
else: else:
super(Gamma, self).impl(x) super(Gamma, self).impl(x)
def grad(self, (x, ), (gz, )): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
if x.type in complex_types: if x.type in complex_types:
raise NotImplementedError() raise NotImplementedError()
if self(x).type in discrete_types: if self(x).type in discrete_types:
...@@ -182,7 +184,9 @@ class Gamma(UnaryScalarOp): ...@@ -182,7 +184,9 @@ class Gamma(UnaryScalarOp):
return gz * gamma(x) * psi(x), return gz * gamma(x) * psi(x),
def c_code(self, node, name, (x, ), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(x,) = inputs
(z,) = outputs
if node.inputs[0].type in float_types: if node.inputs[0].type in float_types:
return """%(z)s = tgamma(%(x)s);""" % locals() return """%(z)s = tgamma(%(x)s);""" % locals()
raise NotImplementedError('only floating point is implemented') raise NotImplementedError('only floating point is implemented')
......
...@@ -490,7 +490,8 @@ class CSMProperties(gof.Op): ...@@ -490,7 +490,8 @@ class CSMProperties(gof.Op):
return gof.Apply(self, [csm], return gof.Apply(self, [csm],
[data, tensor.ivector(), tensor.ivector(), tensor.ivector()]) [data, tensor.ivector(), tensor.ivector(), tensor.ivector()])
def perform(self, node, (csm,), out): def perform(self, node, inputs, out):
(csm,) = inputs
if self.kmap is None: if self.kmap is None:
out[0][0] = csm.data out[0][0] = csm.data
else: else:
...@@ -503,7 +504,7 @@ class CSMProperties(gof.Op): ...@@ -503,7 +504,7 @@ class CSMProperties(gof.Op):
out[2][0] = theano._asarray(csm.indptr, dtype='int32') out[2][0] = theano._asarray(csm.indptr, dtype='int32')
out[3][0] = theano._asarray(csm.shape, dtype='int32') out[3][0] = theano._asarray(csm.shape, dtype='int32')
def grad(self, (csm,), g): def grad(self, inputs, g):
# g[1:] is all integers, so their Jacobian in this op # g[1:] is all integers, so their Jacobian in this op
# is 0. We thus don't need to worry about what their values # is 0. We thus don't need to worry about what their values
...@@ -513,6 +514,7 @@ class CSMProperties(gof.Op): ...@@ -513,6 +514,7 @@ class CSMProperties(gof.Op):
# any gradient anywhere. but we know that at least one of # any gradient anywhere. but we know that at least one of
# g[1:] is connected, or this grad method wouldn't have been # g[1:] is connected, or this grad method wouldn't have been
# called, so we should report zeros # called, so we should report zeros
(csm,) = inputs
if isinstance(g[0].type, DisconnectedType): if isinstance(g[0].type, DisconnectedType):
return [csm.zeros_like()] return [csm.zeros_like()]
...@@ -644,8 +646,10 @@ class CSM(gof.Op): ...@@ -644,8 +646,10 @@ class CSM(gof.Op):
[SparseType(dtype=data.type.dtype, [SparseType(dtype=data.type.dtype,
format=self.format).make_variable()]) format=self.format).make_variable()])
def perform(self, node, (data, indices, indptr, shape), (out,)): def perform(self, node, inputs, outputs):
# for efficiency, if remap does nothing, then do not apply it # for efficiency, if remap does nothing, then do not apply it
(data, indices, indptr, shape) = inputs
(out,) = outputs
if self.kmap is not None: if self.kmap is not None:
data = data[self.kmap] data = data[self.kmap]
...@@ -672,7 +676,9 @@ class CSM(gof.Op): ...@@ -672,7 +676,9 @@ class CSM(gof.Op):
def connection_pattern(self, node): def connection_pattern(self, node):
return [[True], [False], [False], [False]] return [[True], [False], [False], [False]]
def grad(self, (x_data, x_indices, x_indptr, x_shape), (g_out,)): def grad(self, inputs, gout):
(x_data, x_indices, x_indptr, x_shape) = inputs
(g_out,) = gout
g_data, g_indices, g_indptr, g_shape = csm_properties(g_out) g_data, g_indices, g_indptr, g_shape = csm_properties(g_out)
# unpack the data vector and wrap it as a 1d TensorType # unpack the data vector and wrap it as a 1d TensorType
g_data = csm_grad(self.kmap)(x_data, x_indices, x_indptr, x_shape, g_data = csm_grad(self.kmap)(x_data, x_indices, x_indptr, x_shape,
...@@ -773,8 +779,10 @@ class CSMGrad(gof.op.Op): ...@@ -773,8 +779,10 @@ class CSMGrad(gof.op.Op):
return gof.Apply(self, [x_data, x_indices, x_indptr, x_shape, return gof.Apply(self, [x_data, x_indices, x_indptr, x_shape,
g_data, g_indices, g_indptr, g_shape], [gout_data]) g_data, g_indices, g_indptr, g_shape], [gout_data])
def perform(self, node, (x_data, x_indices, x_indptr, x_shape, def perform(self, node, inputs, outputs):
g_data, g_indices, g_indptr, g_shape), (g_out,)): (x_data, x_indices, x_indptr, x_shape,
g_data, g_indices, g_indptr, g_shape) = inputs
(g_out,) = outputs
if len(x_indptr) - 1 == x_shape[0]: if len(x_indptr) - 1 == x_shape[0]:
sp_dim = x_shape[1] sp_dim = x_shape[1]
else: else:
...@@ -826,7 +834,9 @@ class Cast(gof.op.Op): ...@@ -826,7 +834,9 @@ class Cast(gof.op.Op):
self, [x], self, [x],
[SparseType(dtype=self.out_type, format=x.format).make_variable()]) [SparseType(dtype=self.out_type, format=x.format).make_variable()])
def perform(self, node, (x, ), (out, )): def perform(self, node, inputs, outputs):
(x,) = inputs
(out,) = outputs
assert _is_sparse(x) assert _is_sparse(x)
out[0] = x.astype(self.out_type) out[0] = x.astype(self.out_type)
...@@ -848,7 +858,7 @@ class Cast(gof.op.Op): ...@@ -848,7 +858,7 @@ class Cast(gof.op.Op):
return [gz] return [gz]
else: else:
return [Cast(inputs[0].dtype)(gz)] return [Cast(inputs[0].dtype)(gz)]
def infer_shape(self, node, ins_shapes): def infer_shape(self, node, ins_shapes):
return ins_shapes return ins_shapes
...@@ -909,7 +919,9 @@ class DenseFromSparse(gof.op.Op): ...@@ -909,7 +919,9 @@ class DenseFromSparse(gof.op.Op):
broadcastable=(False, False) broadcastable=(False, False)
).make_variable()]) ).make_variable()])
def perform(self, node, (x, ), (out, )): def perform(self, node, inputs, outputs):
(x,) = inputs
(out,) = outputs
if _is_dense(x): if _is_dense(x):
print >> sys.stderr, ( print >> sys.stderr, (
"WARNING: You just called DenseFromSparse on a dense matrix." "WARNING: You just called DenseFromSparse on a dense matrix."
...@@ -919,7 +931,9 @@ class DenseFromSparse(gof.op.Op): ...@@ -919,7 +931,9 @@ class DenseFromSparse(gof.op.Op):
out[0] = x.toarray() out[0] = x.toarray()
assert _is_dense(out[0]) assert _is_dense(out[0])
def grad(self, (x, ), (gz, )): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
if self.sparse_grad: if self.sparse_grad:
left = sp_ones_like(x) left = sp_ones_like(x)
right = gz right = gz
...@@ -989,10 +1003,14 @@ class SparseFromDense(gof.op.Op): ...@@ -989,10 +1003,14 @@ class SparseFromDense(gof.op.Op):
format=self.format format=self.format
).make_variable()]) ).make_variable()])
def perform(self, node, (x, ), (out, )): def perform(self, node, inputs, outputs):
(x,) = inputs
(out,) = outputs
out[0] = SparseType.format_cls[self.format](x) out[0] = SparseType.format_cls[self.format](x)
def grad(self, (x, ), (gz, )): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
gx = dense_from_sparse(gz) gx = dense_from_sparse(gz)
gx = tensor.patternbroadcast(gx, x.broadcastable) gx = tensor.patternbroadcast(gx, x.broadcastable)
return gx, return gx,
...@@ -1035,7 +1053,8 @@ class GetItemList(gof.op.Op): ...@@ -1035,7 +1053,8 @@ class GetItemList(gof.op.Op):
return gof.Apply(self, [x, ind], [x.type()]) return gof.Apply(self, [x, ind], [x.type()])
def perform(self, node, inp, (out, )): def perform(self, node, inp, outputs):
(out,) = outputs
x = inp[0] x = inp[0]
indices = inp[1] indices = inp[1]
assert _is_sparse(x) assert _is_sparse(x)
...@@ -1051,7 +1070,7 @@ class GetItemList(gof.op.Op): ...@@ -1051,7 +1070,7 @@ class GetItemList(gof.op.Op):
return self.__class__.__name__ return self.__class__.__name__
get_item_list = GetItemList() get_item_list = GetItemList()
"""Select row of sparse matrix, """Select row of sparse matrix,
returning them as a new sparse matrix. returning them as a new sparse matrix.
:param x: Sparse matrix. :param x: Sparse matrix.
...@@ -1090,7 +1109,8 @@ class GetItemListGrad(gof.op.Op): ...@@ -1090,7 +1109,8 @@ class GetItemListGrad(gof.op.Op):
return gof.Apply(self, [x, ind, gz], [x.type()]) return gof.Apply(self, [x, ind, gz], [x.type()])
def perform(self, node, inp, (out, )): def perform(self, node, inp, outputs):
(out,) = outputs
x = inp[0] x = inp[0]
indices = inp[1] indices = inp[1]
gz = inp[2] gz = inp[2]
...@@ -1129,7 +1149,8 @@ class GetItem2Lists(gof.op.Op): ...@@ -1129,7 +1149,8 @@ class GetItem2Lists(gof.op.Op):
return gof.Apply(self, [x, ind1, ind2], return gof.Apply(self, [x, ind1, ind2],
[theano.tensor.vector()]) [theano.tensor.vector()])
def perform(self, node, inp, (out, )): def perform(self, node, inp, outputs):
(out,) = outputs
x = inp[0] x = inp[0]
ind1 = inp[1] ind1 = inp[1]
ind2 = inp[2] ind2 = inp[2]
...@@ -1184,7 +1205,8 @@ class GetItem2ListsGrad(gof.op.Op): ...@@ -1184,7 +1205,8 @@ class GetItem2ListsGrad(gof.op.Op):
return gof.Apply(self, [x, ind1, ind2, gz], [x.type()]) return gof.Apply(self, [x, ind1, ind2, gz], [x.type()])
def perform(self, node, inp, (out, )): def perform(self, node, inp, outputs):
(out,) = outputs
x = inp[0] x = inp[0]
ind1 = inp[1] ind1 = inp[1]
ind2 = inp[2] ind2 = inp[2]
...@@ -1292,7 +1314,9 @@ class GetItem2d(gof.op.Op): ...@@ -1292,7 +1314,9 @@ class GetItem2d(gof.op.Op):
return gof.Apply(self, input_op, [x.type()]) return gof.Apply(self, input_op, [x.type()])
def perform(self, node, (x, start1, stop1, step1, start2, stop2, step2), (out, )): def perform(self, node, inputs, outputs):
(x, start1, stop1, step1, start2, stop2, step2) = inputs
(out,) = outputs
assert _is_sparse(x) assert _is_sparse(x)
out[0] = x[start1:stop1:step1, start2:stop2:step2] out[0] = x[start1:stop1:step1, start2:stop2:step2]
...@@ -1364,7 +1388,9 @@ class GetItemScalar(gof.op.Op): ...@@ -1364,7 +1388,9 @@ class GetItemScalar(gof.op.Op):
return gof.Apply(self, input_op, [tensor.scalar(dtype=x.dtype)]) return gof.Apply(self, input_op, [tensor.scalar(dtype=x.dtype)])
def perform(self, node, (x, ind1, ind2), (out, )): def perform(self, node, inputs, outputs):
(x, ind1, ind2) = inputs
(out,) = outputs
assert _is_sparse(x) assert _is_sparse(x)
out[0] = theano._asarray(x[ind1, ind2], x.dtype) out[0] = theano._asarray(x[ind1, ind2], x.dtype)
...@@ -1413,11 +1439,15 @@ class Transpose(gof.op.Op): ...@@ -1413,11 +1439,15 @@ class Transpose(gof.op.Op):
format=self.format_map[x.type.format] format=self.format_map[x.type.format]
).make_variable()]) ).make_variable()])
def perform(self, node, (x, ), (out, )): def perform(self, node, inputs, outputs):
(x,) = inputs
(out,) = outputs
assert _is_sparse(x) assert _is_sparse(x)
out[0] = x.transpose() out[0] = x.transpose()
def grad(self, (x,), (gz,)): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
assert _is_sparse_variable(x) and _is_sparse_variable(gz) assert _is_sparse_variable(x) and _is_sparse_variable(gz)
return transpose(gz), return transpose(gz),
...@@ -1454,11 +1484,15 @@ class Neg(gof.op.Op): ...@@ -1454,11 +1484,15 @@ class Neg(gof.op.Op):
assert x.format in ["csr", "csc"] assert x.format in ["csr", "csc"]
return gof.Apply(self, [x], [x.type()]) return gof.Apply(self, [x], [x.type()])
def perform(self, node, (x, ), (out, )): def perform(self, node, inputs, outputs):
(x,) = inputs
(out,) = outputs
assert _is_sparse(x) assert _is_sparse(x)
out[0] = -x out[0] = -x
def grad(self, (x,), (gz,)): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = outputs
assert _is_sparse_variable(x) and _is_sparse_variable(gz) assert _is_sparse_variable(x) and _is_sparse_variable(gz)
return -gz, return -gz,
...@@ -1500,7 +1534,9 @@ class ColScaleCSC(gof.op.Op): ...@@ -1500,7 +1534,9 @@ class ColScaleCSC(gof.op.Op):
raise ValueError('x was not a csc matrix') raise ValueError('x was not a csc matrix')
return gof.Apply(self, [x, s], [x.type()]) return gof.Apply(self, [x, s], [x.type()])
def perform(self, node, (x, s), (z,)): def perform(self, node, inputs, outputs):
(x, s) = inputs
(z,) = outputs
M, N = x.shape M, N = x.shape
assert x.format == 'csc' assert x.format == 'csc'
assert s.shape == (N, ) assert s.shape == (N, )
...@@ -1512,7 +1548,9 @@ class ColScaleCSC(gof.op.Op): ...@@ -1512,7 +1548,9 @@ class ColScaleCSC(gof.op.Op):
z[0] = y z[0] = y
def grad(self, (x, s), (gz,)): def grad(self, inputs, gout):
(x, s) = inputs
(gz,) = outputs
return [col_scale(gz, s), sp_sum(x * gz, axis=0)] return [col_scale(gz, s), sp_sum(x * gz, axis=0)]
def infer_shape(self, node, ins_shapes): def infer_shape(self, node, ins_shapes):
...@@ -1549,10 +1587,12 @@ class RowScaleCSC(gof.op.Op): ...@@ -1549,10 +1587,12 @@ class RowScaleCSC(gof.op.Op):
assert x.format in ["csr", "csc"] assert x.format in ["csr", "csc"]
return gof.Apply(self, [x, s], [x.type()]) return gof.Apply(self, [x, s], [x.type()])
def perform(self, node, (x, s), (z,)): def perform(self, node, inputs, outputs):
(x, s) = inputs
(z,) = outputs
M, N = x.shape M, N = x.shape
assert x.format == 'csc' assert x.format == 'csc'
assert s.shape == (M, ) assert s.shape == (M,)
indices = x.indices indices = x.indices
indptr = x.indptr indptr = x.indptr
...@@ -1565,7 +1605,9 @@ class RowScaleCSC(gof.op.Op): ...@@ -1565,7 +1605,9 @@ class RowScaleCSC(gof.op.Op):
z[0] = scipy.sparse.csc_matrix((y_data, indices, indptr), (M, N)) z[0] = scipy.sparse.csc_matrix((y_data, indices, indptr), (M, N))
def grad(self, (x, s), (gz,)): def grad(self, inputs, gout):
(x, s) = inputs
(gz,) = outputs
return [row_scale(gz, s), sp_sum(x * gz, axis=1)] return [row_scale(gz, s), sp_sum(x * gz, axis=1)]
def infer_shape(self, node, ins_shapes): def infer_shape(self, node, ins_shapes):
...@@ -1650,13 +1692,17 @@ class SpSum(gof.op.Op): ...@@ -1650,13 +1692,17 @@ class SpSum(gof.op.Op):
z = tensor.TensorType(broadcastable=b, dtype=x.dtype)() z = tensor.TensorType(broadcastable=b, dtype=x.dtype)()
return gof.Apply(self, [x], [z]) return gof.Apply(self, [x], [z])
def perform(self, node, (x,), (z,)): def perform(self, node, inputs, outputs):
(x,) = inputs
(z,) = outputs
if self.axis is None: if self.axis is None:
z[0] = numpy.asarray(x.sum()) z[0] = numpy.asarray(x.sum())
else: else:
z[0] = numpy.asarray(x.sum(self.axis)).ravel() z[0] = numpy.asarray(x.sum(self.axis)).ravel()
def grad(self, (x,), (gz,)): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
if x.dtype not in continuous_dtypes: if x.dtype not in continuous_dtypes:
return [x.zeros_like(dtype=theano.config.floatX)] return [x.zeros_like(dtype=theano.config.floatX)]
if self.structured: if self.structured:
...@@ -1738,13 +1784,17 @@ class Diag(gof.op.Op): ...@@ -1738,13 +1784,17 @@ class Diag(gof.op.Op):
return gof.Apply(self, [x], [tensor.tensor(broadcastable=(False,), return gof.Apply(self, [x], [tensor.tensor(broadcastable=(False,),
dtype=x.dtype)]) dtype=x.dtype)])
def perform(self, node, (x,), (z,)): def perform(self, node, inputs, outputs):
(x,) = inputs
(z,) = outputs
N, M = x.shape N, M = x.shape
if N != M: if N != M:
raise ValueError('Diag only apply on square matrix') raise ValueError('Diag only apply on square matrix')
z[0] = x.diagonal() z[0] = x.diagonal()
def grad(self, (x,), (gz,)): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
return [square_diagonal(gz)] return [square_diagonal(gz)]
def infer_shape(self, nodes, shapes): def infer_shape(self, nodes, shapes):
...@@ -1782,7 +1832,8 @@ class SquareDiagonal(gof.op.Op): ...@@ -1782,7 +1832,8 @@ class SquareDiagonal(gof.op.Op):
return gof.Apply(self, [diag], return gof.Apply(self, [diag],
[SparseType(dtype=diag.dtype, format='csc')()]) [SparseType(dtype=diag.dtype, format='csc')()])
def perform(self, node, inputs, (z,)): def perform(self, node, inputs, outputs):
(z,) = outputs
diag, o_shape = inputs[0], inputs[0].shape * 2 diag, o_shape = inputs[0], inputs[0].shape * 2
N = len(diag) N = len(diag)
...@@ -1793,7 +1844,8 @@ class SquareDiagonal(gof.op.Op): ...@@ -1793,7 +1844,8 @@ class SquareDiagonal(gof.op.Op):
z[0] = scipy.sparse.csc_matrix(tup, copy=True) z[0] = scipy.sparse.csc_matrix(tup, copy=True)
def grad(self, inputs, (gz,)): def grad(self, inputs, gout):
(gz,) = gout
return [diag(gz)] return [diag(gz)]
def infer_shape(self, nodes, shapes): def infer_shape(self, nodes, shapes):
...@@ -1831,7 +1883,9 @@ class EnsureSortedIndices(gof.op.Op): ...@@ -1831,7 +1883,9 @@ class EnsureSortedIndices(gof.op.Op):
assert x.format in ["csr", "csc"] assert x.format in ["csr", "csc"]
return gof.Apply(self, [x], [x.type()]) return gof.Apply(self, [x], [x.type()])
def perform(self, node, (x, ), (z, )): def perform(self, node, inputs, outputs):
(x,) = inputs
(z,) = outputs
if self.inplace: if self.inplace:
z[0] = x.sort_indices() z[0] = x.sort_indices()
else: else:
...@@ -1906,12 +1960,16 @@ class AddSS(gof.op.Op): ...@@ -1906,12 +1960,16 @@ class AddSS(gof.op.Op):
format=x.type.format format=x.type.format
).make_variable()]) ).make_variable()])
def perform(self, node, (x, y), (out, )): def perform(self, node, inputs, outputs):
(x, y) = inputs
(out,) = outputs
assert _is_sparse(x) and _is_sparse(y) assert _is_sparse(x) and _is_sparse(y)
assert x.shape == y.shape assert x.shape == y.shape
out[0] = x + y out[0] = x + y
def grad(self, (x, y), (gz,)): def grad(self, inputs, gout):
(x, y) = inputs
(gz,) = gout
assert _is_sparse_variable(x) and _is_sparse_variable(y) assert _is_sparse_variable(x) and _is_sparse_variable(y)
assert _is_sparse_variable(gz) assert _is_sparse_variable(gz)
return gz, gz return gz, gz
...@@ -1943,14 +2001,17 @@ class AddSSData(gof.op.Op): ...@@ -1943,14 +2001,17 @@ class AddSSData(gof.op.Op):
[SparseType(dtype=x.type.dtype, [SparseType(dtype=x.type.dtype,
format=x.type.format).make_variable()]) format=x.type.format).make_variable()])
def perform(self, node, (x, y), (out, )): def perform(self, node, inputs, outputs):
(x, y) = inputs
(out,) = outputs
assert _is_sparse(x) and _is_sparse(y) assert _is_sparse(x) and _is_sparse(y)
assert x.shape == y.shape assert x.shape == y.shape
assert x.data.shape == y.data.shape assert x.data.shape == y.data.shape
out[0] = x.copy() out[0] = x.copy()
out[0].data += y.data out[0].data += y.data
def grad(self, inputs, (gz, )): def grad(self, inputs, gout):
(gz,) = gout
is_continuous = [(i.dtype in continuous_dtypes) is_continuous = [(i.dtype in continuous_dtypes)
for i in inputs] for i in inputs]
derivative = {True: gz, False: None} derivative = {True: gz, False: None}
...@@ -2006,14 +2067,18 @@ class AddSD(gof.op.Op): ...@@ -2006,14 +2067,18 @@ class AddSD(gof.op.Op):
broadcastable=y.type.broadcastable broadcastable=y.type.broadcastable
).make_variable()]) ).make_variable()])
def perform(self, node, (x, y), (out, )): def perform(self, node, inputs, outputs):
(x, y) = inputs
(out,) = outputs
assert _is_dense(y) assert _is_dense(y)
# The asarray is needed as in some case, this return a # The asarray is needed as in some case, this return a
# numpy.matrixlib.defmatrix.matrix object and not an ndarray. # numpy.matrixlib.defmatrix.matrix object and not an ndarray.
out[0] = theano._asarray(x + y, dtype=node.outputs[0].type.dtype) out[0] = theano._asarray(x + y, dtype=node.outputs[0].type.dtype)
def grad(self, (x, y), (gz,)): def grad(self, inputs, gout):
(x, y) = inputs
(gz,) = gout
assert _is_sparse_variable(x) and _is_dense_variable(y) assert _is_sparse_variable(x) and _is_dense_variable(y)
assert _is_dense_variable(gz) assert _is_dense_variable(gz)
return sp_ones_like(x) * gz, gz return sp_ones_like(x) * gz, gz
...@@ -2045,12 +2110,16 @@ class StructuredAddSV(gof.op.Op): ...@@ -2045,12 +2110,16 @@ class StructuredAddSV(gof.op.Op):
[SparseType(dtype=x.type.dtype, [SparseType(dtype=x.type.dtype,
format=x.type.format).make_variable()]) format=x.type.format).make_variable()])
def perform(self, node, (x, y), (out, )): def perform(self, node, inputs, outputs):
(x, y) = inputs
(out,) = outputs
assert _is_sparse(x) and not _is_sparse(y) assert _is_sparse(x) and not _is_sparse(y)
assert x.shape[1] == y.shape[0] assert x.shape[1] == y.shape[0]
out[0] = x.__class__(x + (x.toarray() != 0) * y) out[0] = x.__class__(x + (x.toarray() != 0) * y)
def grad(self, (x, y), (gz,)): def grad(self, inputs, gout):
(x, y) = inputs
(gz,) = gout
assert _is_sparse_variable(x) and not _is_sparse_variable(y) assert _is_sparse_variable(x) and not _is_sparse_variable(y)
assert _is_sparse_variable(gz) assert _is_sparse_variable(gz)
return gz, sp_sum(gz, axis=0, sparse_grad=True) return gz, sp_sum(gz, axis=0, sparse_grad=True)
...@@ -2156,7 +2225,9 @@ class MulSS(gof.op.Op): ...@@ -2156,7 +2225,9 @@ class MulSS(gof.op.Op):
format=x.type.format format=x.type.format
)()]) )()])
def perform(self, node, (x, y), (out, )): def perform(self, node, inputs, outputs):
(x, y) = inputs
(out,) = outputs
assert _is_sparse(x) and _is_sparse(y) assert _is_sparse(x) and _is_sparse(y)
assert len(x.shape) == 2 assert len(x.shape) == 2
assert y.shape == x.shape assert y.shape == x.shape
...@@ -2164,7 +2235,9 @@ class MulSS(gof.op.Op): ...@@ -2164,7 +2235,9 @@ class MulSS(gof.op.Op):
# x * y calls dot... # x * y calls dot...
out[0] = x.multiply(y) out[0] = x.multiply(y)
def grad(self, (x, y), (gz,)): def grad(self, inputs, gout):
(x, y) = inputs
(gz,) = gout
return y * gz, x * gz return y * gz, x * gz
def infer_shape(self, node, shapes): def infer_shape(self, node, shapes):
...@@ -2202,7 +2275,9 @@ class MulSD(gof.op.Op): ...@@ -2202,7 +2275,9 @@ class MulSD(gof.op.Op):
format=x.type.format)() format=x.type.format)()
return gof.Apply(self, [x, y], [out]) return gof.Apply(self, [x, y], [out])
def perform(self, node, (x, y), (out, )): def perform(self, node, inputs, outputs):
(x, y) = inputs
(out,) = outputs
assert _is_sparse(x) and _is_dense(y) assert _is_sparse(x) and _is_dense(y)
if len(y.shape) == 0: if len(y.shape) == 0:
out_dtype = node.outputs[0].dtype out_dtype = node.outputs[0].dtype
...@@ -2258,7 +2333,9 @@ class MulSD(gof.op.Op): ...@@ -2258,7 +2333,9 @@ class MulSD(gof.op.Op):
), x.format ), x.format
out[0] = type(x)(x.toarray() * y) out[0] = type(x)(x.toarray() * y)
def grad(self, (x, y), (gz,)): def grad(self, inputs, gout):
(x, y) = inputs
(gz,) = gout
assert _is_sparse_variable(x) and _is_dense_variable(y) assert _is_sparse_variable(x) and _is_dense_variable(y)
assert _is_sparse_variable(gz) assert _is_sparse_variable(gz)
return y * gz, dense_from_sparse(x * gz) return y * gz, dense_from_sparse(x * gz)
...@@ -2291,12 +2368,16 @@ class MulSV(gof.op.Op): ...@@ -2291,12 +2368,16 @@ class MulSV(gof.op.Op):
[SparseType(dtype=x.type.dtype, [SparseType(dtype=x.type.dtype,
format=x.type.format).make_variable()]) format=x.type.format).make_variable()])
def perform(self, node, (x, y), (out, )): def perform(self, node, inputs, outputs):
(x, y) = inputs
(out,) = outputs
assert _is_sparse(x) and not _is_sparse(y) assert _is_sparse(x) and not _is_sparse(y)
assert x.shape[1] == y.shape[0] assert x.shape[1] == y.shape[0]
out[0] = x.__class__(x.toarray() * y) out[0] = x.__class__(x.toarray() * y)
def grad(self, (x, y), (gz,)): def grad(self, inputs, gout):
(x, y) = inputs
(gz,) = gout
assert _is_sparse_variable(x) and _is_dense_variable(y) assert _is_sparse_variable(x) and _is_dense_variable(y)
assert _is_sparse_variable(gz) assert _is_sparse_variable(gz)
...@@ -2402,7 +2483,9 @@ class __ComparisonOpSS(gof.op.Op): ...@@ -2402,7 +2483,9 @@ class __ComparisonOpSS(gof.op.Op):
[SparseType(dtype='uint8', [SparseType(dtype='uint8',
format=x.type.format).make_variable()]) format=x.type.format).make_variable()])
def perform(self, node, (x, y), (out, )): def perform(self, node, inputs, outputs):
(x, y) = inputs
(out,) = outputs
assert _is_sparse(x) and _is_sparse(y) assert _is_sparse(x) and _is_sparse(y)
assert x.shape == y.shape assert x.shape == y.shape
out[0] = self.comparison(x, y).astype('uint8') out[0] = self.comparison(x, y).astype('uint8')
...@@ -2444,7 +2527,9 @@ class __ComparisonOpSD(gof.op.Op): ...@@ -2444,7 +2527,9 @@ class __ComparisonOpSD(gof.op.Op):
[SparseType(dtype='uint8', [SparseType(dtype='uint8',
format=x.type.format).make_variable()]) format=x.type.format).make_variable()])
def perform(self, node, (x, y), (out, )): def perform(self, node, inputs, outputs):
(x, y) = inputs
(out,) = outputs
assert _is_sparse(x) assert _is_sparse(x)
assert x.shape == y.shape assert x.shape == y.shape
assert _is_dense(y) assert _is_dense(y)
...@@ -2682,7 +2767,8 @@ class HStack(gof.op.Op): ...@@ -2682,7 +2767,8 @@ class HStack(gof.op.Op):
self, var, self, var,
[SparseType(dtype=self.dtype, format=self.format).make_variable()]) [SparseType(dtype=self.dtype, format=self.format).make_variable()])
def perform(self, node, block, (out, )): def perform(self, node, block, outputs):
(out,) = outputs
for b in block: for b in block:
assert _is_sparse(b) assert _is_sparse(b)
out[0] = scipy.sparse.hstack(block, format=self.format, out[0] = scipy.sparse.hstack(block, format=self.format,
...@@ -2692,7 +2778,8 @@ class HStack(gof.op.Op): ...@@ -2692,7 +2778,8 @@ class HStack(gof.op.Op):
if out[0].dtype != self.dtype: if out[0].dtype != self.dtype:
out[0] = out[0].astype(self.dtype) out[0] = out[0].astype(self.dtype)
def grad(self, inputs, (gz, )): def grad(self, inputs, gout):
(gz,) = gout
is_continuous = [(inputs[i].dtype in tensor.continuous_dtypes) is_continuous = [(inputs[i].dtype in tensor.continuous_dtypes)
for i in range(len(inputs))] for i in range(len(inputs))]
...@@ -2749,7 +2836,8 @@ def hstack(blocks, format=None, dtype=None): ...@@ -2749,7 +2836,8 @@ def hstack(blocks, format=None, dtype=None):
class VStack(HStack): class VStack(HStack):
# See doc in instance of this Op or function after this class definition. # See doc in instance of this Op or function after this class definition.
def perform(self, node, block, (out, )): def perform(self, node, block, outputs):
(out,) = outputs
for b in block: for b in block:
assert _is_sparse(b) assert _is_sparse(b)
out[0] = scipy.sparse.vstack(block, format=self.format, out[0] = scipy.sparse.vstack(block, format=self.format,
...@@ -2759,7 +2847,8 @@ class VStack(HStack): ...@@ -2759,7 +2847,8 @@ class VStack(HStack):
if out[0].dtype != self.dtype: if out[0].dtype != self.dtype:
out[0] = out[0].astype(self.dtype) out[0] = out[0].astype(self.dtype)
def grad(self, inputs, (gz, )): def grad(self, inputs, gout):
(gz,) = gout
is_continuous = [(inputs[i].dtype in tensor.continuous_dtypes) is_continuous = [(inputs[i].dtype in tensor.continuous_dtypes)
for i in range(len(inputs))] for i in range(len(inputs))]
...@@ -2836,7 +2925,9 @@ class Remove0(gof.Op): ...@@ -2836,7 +2925,9 @@ class Remove0(gof.Op):
assert x.format in ["csr", "csc"] assert x.format in ["csr", "csc"]
return gof.Apply(self, [x], [x.type()]) return gof.Apply(self, [x], [x.type()])
def perform(self, node, (x,), (z,)): def perform(self, node, inputs, outputs):
(x,) = inputs
(z,) = outputs
if self.inplace: if self.inplace:
c = x c = x
else: else:
...@@ -2844,7 +2935,9 @@ class Remove0(gof.Op): ...@@ -2844,7 +2935,9 @@ class Remove0(gof.Op):
c.eliminate_zeros() c.eliminate_zeros()
z[0] = c z[0] = c
def grad(self, (x,), (gz,)): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
return [gz] return [gz]
def infer_shape(self, node, i0_shapes): def infer_shape(self, node, i0_shapes):
...@@ -3157,7 +3250,9 @@ class TrueDot(gof.op.Op): ...@@ -3157,7 +3250,9 @@ class TrueDot(gof.op.Op):
shape, copy=False) shape, copy=False)
out[0] = rval out[0] = rval
def grad(self, (x, y), (gz, )): def grad(self, inputs, gout):
(x, y) = inputs
(gz,) = gout
assert _is_sparse_variable(gz) assert _is_sparse_variable(gz)
assert _is_sparse_variable(x) assert _is_sparse_variable(x)
...@@ -3246,7 +3341,9 @@ class StructuredDot(gof.Op): ...@@ -3246,7 +3341,9 @@ class StructuredDot(gof.Op):
[tensor.tensor(dtype_out, [tensor.tensor(dtype_out,
(False, b.type.broadcastable[1]))]) (False, b.type.broadcastable[1]))])
def perform(self, node, (a, b), (out,)): def perform(self, node, inputs, outputs):
(a, b) = inputs
(out,) = outputs
if a.shape[1] != b.shape[0]: if a.shape[1] != b.shape[0]:
raise ValueError('shape mismatch in StructuredDot.perform', raise ValueError('shape mismatch in StructuredDot.perform',
(a.shape, b.shape)) (a.shape, b.shape))
...@@ -3287,10 +3384,12 @@ class StructuredDot(gof.Op): ...@@ -3287,10 +3384,12 @@ class StructuredDot(gof.Op):
# theano._asarray function documentation. # theano._asarray function documentation.
out[0] = theano._asarray(variable, str(variable.dtype)) out[0] = theano._asarray(variable, str(variable.dtype))
def grad(self, (a, b), (g_out,)): def grad(self, inputs, gout):
# a is sparse, b is dense, g_out is dense # a is sparse, b is dense, g_out is dense
# ga = g_out x b.T # ga = g_out x b.T
# gb = a.T x g_out # gb = a.T x g_out
(a, b) = inputs
(g_out,) = gout
return [structured_dot_grad(a, b, g_out), structured_dot(a.T, g_out)] return [structured_dot_grad(a, b, g_out), structured_dot(a.T, g_out)]
def infer_shape(self, node, shapes): def infer_shape(self, node, shapes):
...@@ -3367,7 +3466,9 @@ class StructuredDotGradCSC(gof.Op): ...@@ -3367,7 +3466,9 @@ class StructuredDotGradCSC(gof.Op):
return gof.Apply(self, [a_indices, a_indptr, b, g_ab], return gof.Apply(self, [a_indices, a_indptr, b, g_ab],
[tensor.tensor(g_ab.dtype, (False,))]) [tensor.tensor(g_ab.dtype, (False,))])
def perform(self, node, (a_indices, a_indptr, b, g_ab), (out,)): def perform(self, node, inputs, outputs):
(a_indices, a_indptr, b, g_ab) = inputs
(out,) = outputs
g_a_data = numpy.zeros(a_indices.shape, dtype=g_ab.dtype) g_a_data = numpy.zeros(a_indices.shape, dtype=g_ab.dtype)
for j in xrange(len(a_indptr) - 1): for j in xrange(len(a_indptr) - 1):
ind0 = a_indptr[j] ind0 = a_indptr[j]
...@@ -3386,8 +3487,10 @@ class StructuredDotGradCSC(gof.Op): ...@@ -3386,8 +3487,10 @@ class StructuredDotGradCSC(gof.Op):
def c_code_cache_version(self): def c_code_cache_version(self):
return (1,) return (1,)
def c_code(self, node, name, (_indices, _indptr, _d, _g), (_zout, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(_indices, _indptr, _d, _g) = inputs
(_zout,) = outputs
if node.inputs[2].type.dtype in ('complex64', 'complex128'): if node.inputs[2].type.dtype in ('complex64', 'complex128'):
raise NotImplementedError('Complex types are not supported for b') raise NotImplementedError('Complex types are not supported for b')
if node.inputs[3].type.dtype in ('complex64', 'complex128'): if node.inputs[3].type.dtype in ('complex64', 'complex128'):
...@@ -3501,7 +3604,9 @@ class StructuredDotGradCSR(gof.Op): ...@@ -3501,7 +3604,9 @@ class StructuredDotGradCSR(gof.Op):
return gof.Apply(self, [a_indices, a_indptr, b, g_ab], return gof.Apply(self, [a_indices, a_indptr, b, g_ab],
[tensor.tensor(b.dtype, (False,))]) [tensor.tensor(b.dtype, (False,))])
def perform(self, node, (a_indices, a_indptr, b, g_ab), (out,)): def perform(self, node, inputs, outputs):
(a_indices, a_indptr, b, g_ab) = inputs
(out,) = outputs
g_a_data = numpy.zeros(a_indices.shape, dtype=g_ab.dtype) g_a_data = numpy.zeros(a_indices.shape, dtype=g_ab.dtype)
for i in xrange(len(a_indptr) - 1): # loop over rows for i in xrange(len(a_indptr) - 1): # loop over rows
ind0 = a_indptr[i] ind0 = a_indptr[i]
...@@ -3522,8 +3627,10 @@ class StructuredDotGradCSR(gof.Op): ...@@ -3522,8 +3627,10 @@ class StructuredDotGradCSR(gof.Op):
def c_code_cache_version(self): def c_code_cache_version(self):
return (1,) return (1,)
def c_code(self, node, name, (_indices, _indptr, _d, _g), (_zout, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(_indices, _indptr, _d, _g) = inputs
(_zout,) = outputs
if node.inputs[2].type.dtype in ('complex64', 'complex128'): if node.inputs[2].type.dtype in ('complex64', 'complex128'):
raise NotImplementedError('Complex types are not supported for b') raise NotImplementedError('Complex types are not supported for b')
if node.inputs[3].type.dtype in ('complex64', 'complex128'): if node.inputs[3].type.dtype in ('complex64', 'complex128'):
...@@ -3651,7 +3758,9 @@ class SamplingDot(gof.op.Op): ...@@ -3651,7 +3758,9 @@ class SamplingDot(gof.op.Op):
return gof.Apply(self, [x, y, p], [p.type()]) return gof.Apply(self, [x, y, p], [p.type()])
def perform(self, node, (x, y, p), (out,)): def perform(self, node, inputs, outputs):
(x, y, p) = inputs
(out,) = outputs
if _is_sparse(x): if _is_sparse(x):
raise TypeError(x) raise TypeError(x)
...@@ -3663,7 +3772,9 @@ class SamplingDot(gof.op.Op): ...@@ -3663,7 +3772,9 @@ class SamplingDot(gof.op.Op):
out[0] = p.__class__(p.multiply(numpy.dot(x, y.T))) out[0] = p.__class__(p.multiply(numpy.dot(x, y.T)))
def grad(self, (x, y, p), (gz,)): def grad(self, inputs, gout):
(x, y, p) = inputs
(gz,) = gout
rval = [ rval = [
dot(p * gz, y), dot(p * gz, y),
dot((p * gz).T, x), dot((p * gz).T, x),
...@@ -3787,7 +3898,9 @@ class Dot(gof.op.Op): ...@@ -3787,7 +3898,9 @@ class Dot(gof.op.Op):
out[0] = theano._asarray(rval, dtype=node.outputs[0].dtype) out[0] = theano._asarray(rval, dtype=node.outputs[0].dtype)
def grad(self, (x, y), (gz,)): def grad(self, inputs, gout):
(x, y) = inputs
(gz,) = gout
assert _is_sparse_variable(x) or _is_sparse_variable(y) assert _is_sparse_variable(x) or _is_sparse_variable(y)
rval = [] rval = []
...@@ -3876,7 +3989,9 @@ class Usmm(gof.op.Op): ...@@ -3876,7 +3989,9 @@ class Usmm(gof.op.Op):
[tensor.tensor(dtype=dtype_out, [tensor.tensor(dtype=dtype_out,
broadcastable=(False, False))]) broadcastable=(False, False))])
def perform(self, node, (alpha, x, y, z), (out, )): def perform(self, node, inputs, outputs):
(alpha, x, y, z) = inputs
(out,) = outputs
x_is_sparse = _is_sparse(x) x_is_sparse = _is_sparse(x)
y_is_sparse = _is_sparse(y) y_is_sparse = _is_sparse(y)
......
...@@ -105,7 +105,9 @@ class AddSD_ccode(gof.op.Op): ...@@ -105,7 +105,9 @@ class AddSD_ccode(gof.op.Op):
[data, indices, indptr, y], [data, indices, indptr, y],
[out]) [out])
def c_code(self, node, name, (_data, _indices, _indptr, y), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(_data, _indices, _indptr, y) = inputs
(z,) = outputs
inplace = int(self.inplace) inplace = int(self.inplace)
format = {'csc': 0, 'csr': 1}[self.format] format = {'csc': 0, 'csr': 1}[self.format]
out_typenum = node.outputs[0].type.dtype_specs()[2] out_typenum = node.outputs[0].type.dtype_specs()[2]
...@@ -236,7 +238,9 @@ class StructuredDotCSC(gof.Op): ...@@ -236,7 +238,9 @@ class StructuredDotCSC(gof.Op):
[tensor.tensor(dtype_out, (False, b.type.broadcastable[1]))]) [tensor.tensor(dtype_out, (False, b.type.broadcastable[1]))])
return r return r
def perform(self, node, (a_val, a_ind, a_ptr, a_nrows, b), (out,)): def perform(self, node, inputs, outputs):
(a_val, a_ind, a_ptr, a_nrows, b) = inputs
(out,) = outputs
a = scipy.sparse.csc_matrix((a_val, a_ind, a_ptr), a = scipy.sparse.csc_matrix((a_val, a_ind, a_ptr),
(a_nrows, b.shape[0]), (a_nrows, b.shape[0]),
copy=False) copy=False)
...@@ -244,7 +248,7 @@ class StructuredDotCSC(gof.Op): ...@@ -244,7 +248,7 @@ class StructuredDotCSC(gof.Op):
out[0] = theano._asarray(a * b, dtype=node.outputs[0].type.dtype) out[0] = theano._asarray(a * b, dtype=node.outputs[0].type.dtype)
assert _is_dense(out[0]) # scipy 0.7 automatically converts to dense assert _is_dense(out[0]) # scipy 0.7 automatically converts to dense
def c_code(self, node, name, (a_val, a_ind, a_ptr, a_nrows, b), (z,), sub): def c_code(self, node, name, inputs, outputs, sub):
# C-implementation of the dot product of the sparse matrix A and matrix # C-implementation of the dot product of the sparse matrix A and matrix
# B. # B.
# @param a_val: non-zero values of the sparse matrix # @param a_val: non-zero values of the sparse matrix
...@@ -257,6 +261,8 @@ class StructuredDotCSC(gof.Op): ...@@ -257,6 +261,8 @@ class StructuredDotCSC(gof.Op):
# @param z: return value # @param z: return value
# @param sub: TODO, not too sure, something to do with weave probably # @param sub: TODO, not too sure, something to do with weave probably
(a_val, a_ind, a_ptr, a_nrows, b) = inputs
(z,) = outputs
if node.inputs[0].type.dtype in ('complex64', 'complex128'): if node.inputs[0].type.dtype in ('complex64', 'complex128'):
raise NotImplementedError('Complex types are not supported for a_val') raise NotImplementedError('Complex types are not supported for a_val')
if node.inputs[4].type.dtype in ('complex64', 'complex128'): if node.inputs[4].type.dtype in ('complex64', 'complex128'):
...@@ -426,7 +432,9 @@ class StructuredDotCSR(gof.Op): ...@@ -426,7 +432,9 @@ class StructuredDotCSR(gof.Op):
b.type.broadcastable[1]))]) b.type.broadcastable[1]))])
return r return r
def perform(self, node, (a_val, a_ind, a_ptr, b), (out,)): def perform(self, node, inputs, outputs):
(a_val, a_ind, a_ptr, b) = inputs
(out,) = outputs
a = scipy.sparse.csr_matrix((a_val, a_ind, a_ptr), a = scipy.sparse.csr_matrix((a_val, a_ind, a_ptr),
(len(a_ptr) - 1, b.shape[0]), (len(a_ptr) - 1, b.shape[0]),
copy=True) # use view_map before setting this to False copy=True) # use view_map before setting this to False
...@@ -435,7 +443,7 @@ class StructuredDotCSR(gof.Op): ...@@ -435,7 +443,7 @@ class StructuredDotCSR(gof.Op):
# scipy 0.7 automatically converts to dense, but not .6 sometimes # scipy 0.7 automatically converts to dense, but not .6 sometimes
assert _is_dense(out[0]) assert _is_dense(out[0])
def c_code(self, node, name, (a_val, a_ind, a_ptr, b), (z,), sub): def c_code(self, node, name, inputs, outputs, sub):
""" """
C-implementation of the dot product of the sparse matrix A and matrix C-implementation of the dot product of the sparse matrix A and matrix
B. B.
...@@ -449,7 +457,8 @@ class StructuredDotCSR(gof.Op): ...@@ -449,7 +457,8 @@ class StructuredDotCSR(gof.Op):
@param z: return value @param z: return value
@param sub: TODO, not too sure, something to do with weave probably @param sub: TODO, not too sure, something to do with weave probably
""" """
# retrieve dtype number (a_val, a_ind, a_ptr, b) = inputs
(z,) = outputs
typenum_z = tensor.TensorType(self.dtype_out, []).dtype_specs()[2] typenum_z = tensor.TensorType(self.dtype_out, []).dtype_specs()[2]
if node.inputs[0].type.dtype in ('complex64', 'complex128'): if node.inputs[0].type.dtype in ('complex64', 'complex128'):
raise NotImplementedError('Complex types are not supported for a_val') raise NotImplementedError('Complex types are not supported for a_val')
...@@ -890,9 +899,11 @@ class CSMGradC(gof.Op): ...@@ -890,9 +899,11 @@ class CSMGradC(gof.Op):
return gof.Apply(self, [a_val, a_ind, a_ptr, a_dim, return gof.Apply(self, [a_val, a_ind, a_ptr, a_dim,
b_val, b_ind, b_ptr, b_dim], [b_val.type()]) b_val, b_ind, b_ptr, b_dim], [b_val.type()])
def c_code(self, node, name, (a_val, a_ind, a_ptr, a_dim, def c_code(self, node, name, inputs, outputs, sub):
b_val, b_ind, b_ptr, b_dim), (z,), sub):
# retrieve dtype number # retrieve dtype number
(a_val, a_ind, a_ptr, a_dim,
b_val, b_ind, b_ptr, b_dim) = inputs
(z,) = outputs
typenum_z = node.outputs[0].type.dtype_specs()[2] typenum_z = node.outputs[0].type.dtype_specs()[2]
if node.inputs[0].type.dtype in ('complex64', 'complex128'): if node.inputs[0].type.dtype in ('complex64', 'complex128'):
raise NotImplementedError('Complex types are not supported for a_val') raise NotImplementedError('Complex types are not supported for a_val')
...@@ -1047,9 +1058,10 @@ class MulSDCSC(gof.Op): ...@@ -1047,9 +1058,10 @@ class MulSDCSC(gof.Op):
# def perform(self, node, (a_data, a_indices, a_indptr, b), (out,)): # def perform(self, node, (a_data, a_indices, a_indptr, b), (out,)):
# return NotImplementedError() # return NotImplementedError()
def c_code(self, node, name, (_data, _indices, _indptr, _b,), def c_code(self, node, name, inputs, outputs, sub):
(_zout, ), sub):
(_data, _indices, _indptr, _b,) = inputs
(_zout,) = outputs
if node.inputs[0].type.dtype in ('complex64', 'complex128'): if node.inputs[0].type.dtype in ('complex64', 'complex128'):
raise NotImplementedError('Complex types are not supported for a') raise NotImplementedError('Complex types are not supported for a')
if node.inputs[3].type.dtype in ('complex64', 'complex128'): if node.inputs[3].type.dtype in ('complex64', 'complex128'):
...@@ -1163,9 +1175,10 @@ class MulSDCSR(gof.Op): ...@@ -1163,9 +1175,10 @@ class MulSDCSR(gof.Op):
# def perform(self, node, (a_data, a_indices, a_indptr, b), (out,)): # def perform(self, node, (a_data, a_indices, a_indptr, b), (out,)):
# return NotImplemented() # return NotImplemented()
def c_code(self, node, name, (_data, _indices, _indptr, _b,), def c_code(self, node, name, inputs, outputs, sub):
(_zout, ), sub):
(_data, _indices, _indptr, _b,) = inputs
(_zout,) = outputs
if node.inputs[0].type.dtype in ('complex64', 'complex128'): if node.inputs[0].type.dtype in ('complex64', 'complex128'):
raise NotImplementedError('Complex types are not supported for a') raise NotImplementedError('Complex types are not supported for a')
if node.inputs[3].type.dtype in ('complex64', 'complex128'): if node.inputs[3].type.dtype in ('complex64', 'complex128'):
......
...@@ -42,18 +42,20 @@ class ConvolutionIndices(Op): ...@@ -42,18 +42,20 @@ class ConvolutionIndices(Op):
""" """
@staticmethod @staticmethod
def sparse_eval(inshp, kshp, nkern, (dx, dy)=(1, 1), mode='valid'): def sparse_eval(inshp, kshp, nkern, strides=(1, 1), mode='valid'):
(dx, dy) = strides
return convolution_indices.evaluate(inshp, kshp, (dx, dy), return convolution_indices.evaluate(inshp, kshp, (dx, dy),
nkern, mode=mode, ws=False) nkern, mode=mode, ws=False)
@staticmethod @staticmethod
def conv_eval(inshp, kshp, (dx, dy)=(1, 1), mode='valid'): def conv_eval(inshp, kshp, strides=(1, 1), mode='valid'):
(dx, dy) = strides
return convolution_indices.evaluate(inshp, kshp, (dx, dy), return convolution_indices.evaluate(inshp, kshp, (dx, dy),
mode=mode, ws=True) mode=mode, ws=True)
# img_shape and ker_shape are (height,width) # img_shape and ker_shape are (height,width)
@staticmethod @staticmethod
def evaluate(inshp, kshp, (dx, dy)=(1, 1), nkern=1, mode='valid', ws=True): def evaluate(inshp, kshp, strides=(1, 1), nkern=1, mode='valid', ws=True):
"""Build a sparse matrix which can be used for performing... """Build a sparse matrix which can be used for performing...
* convolution: in this case, the dot product of this matrix * convolution: in this case, the dot product of this matrix
with the input images will generate a stack of images with the input images will generate a stack of images
...@@ -79,6 +81,7 @@ class ConvolutionIndices(Op): ...@@ -79,6 +81,7 @@ class ConvolutionIndices(Op):
:returns: the structure of a sparse matrix, and the logical dimensions :returns: the structure of a sparse matrix, and the logical dimensions
of the image which will be the result of filtering. of the image which will be the result of filtering.
""" """
(dx, dy) = strides
N = numpy N = numpy
# inshp contains either 2 entries (height,width) or 3 (nfeatures,h,w) # inshp contains either 2 entries (height,width) or 3 (nfeatures,h,w)
...@@ -251,8 +254,9 @@ class ConvolutionIndices(Op): ...@@ -251,8 +254,9 @@ class ConvolutionIndices(Op):
return rval return rval
def perform(self, node, (inshp, kshp),\ def perform(self, node, inputs, outputs):
(out_indices, out_indptr, spmat_shape)): (inshp, kshp) = inputs
(out_indices, out_indptr, spmat_shape) = outputs
indices, indptr, spmatshp, outshp = self.evaluate(inshp, kshp) indices, indptr, spmatshp, outshp = self.evaluate(inshp, kshp)
out_indices[0] = indices out_indices[0] = indices
out_indptr[0] = indptr out_indptr[0] = indptr
......
...@@ -71,7 +71,9 @@ class Poisson(gof.op.Op): ...@@ -71,7 +71,9 @@ class Poisson(gof.op.Op):
x = as_sparse_variable(x) x = as_sparse_variable(x)
return gof.Apply(self, [x], [x.type()]) return gof.Apply(self, [x], [x.type()])
def perform(self, node, (x, ), (out, )): def perform(self, node, inputs, outputs):
(x,) = inputs
(out,) = outputs
assert _is_sparse(x) assert _is_sparse(x)
assert x.format in ["csr", "csc"] assert x.format in ["csr", "csc"]
out[0] = x.copy() out[0] = x.copy()
...@@ -130,7 +132,9 @@ class Binomial(gof.op.Op): ...@@ -130,7 +132,9 @@ class Binomial(gof.op.Op):
[SparseType(dtype=self.dtype, [SparseType(dtype=self.dtype,
format=self.format).make_variable()]) format=self.format).make_variable()])
def perform(self, node, (n, p, shape, ), (out, )): def perform(self, node, inputs, outputs):
(n, p, shape) = inputs
(out,) = outputs
binomial = numpy.random.binomial(n, p, size=shape) binomial = numpy.random.binomial(n, p, size=shape)
csx_matrix = getattr(scipy.sparse, self.format + '_matrix') csx_matrix = getattr(scipy.sparse, self.format + '_matrix')
out[0] = csx_matrix(binomial, dtype=self.dtype) out[0] = csx_matrix(binomial, dtype=self.dtype)
...@@ -138,7 +142,9 @@ class Binomial(gof.op.Op): ...@@ -138,7 +142,9 @@ class Binomial(gof.op.Op):
def connection_pattern(self, node): def connection_pattern(self, node):
return [[True], [True], [False]] return [[True], [True], [False]]
def grad(self, (n, p, shape, ), (gz,)): def grad(self, inputs, gout):
(n, p, shape) = inputs
(gz,) = gout
comment_n = "No gradient exists for the number of samples in class\ comment_n = "No gradient exists for the number of samples in class\
Binomial of theano/sparse/sandbox/sp2.py" Binomial of theano/sparse/sandbox/sp2.py"
comment_p = "No gradient exists for the prob of success in class\ comment_p = "No gradient exists for the prob of success in class\
...@@ -196,7 +202,9 @@ class Multinomial(gof.op.Op): ...@@ -196,7 +202,9 @@ class Multinomial(gof.op.Op):
return gof.Apply(self, [n, p], [p.type()]) return gof.Apply(self, [n, p], [p.type()])
def perform(self, node, (n, p), (out, )): def perform(self, node, inputs, outputs):
(n, p) = inputs
(out,) = outputs
assert _is_sparse(p) assert _is_sparse(p)
if p.format != 'csr': if p.format != 'csr':
......
...@@ -186,11 +186,15 @@ class T_verify_grad_sparse(unittest.TestCase): ...@@ -186,11 +186,15 @@ class T_verify_grad_sparse(unittest.TestCase):
x = as_sparse_variable(x) x = as_sparse_variable(x)
return gof.Apply(self, [x], [x.type()]) return gof.Apply(self, [x], [x.type()])
def perform(self, node, (x, ), (out, )): def perform(self, node, inputs, outputs):
(x,) = inputs
(out,) = outputs
assert _is_sparse(x) assert _is_sparse(x)
out[0] = -x out[0] = -x
def grad(self, (x,), (gz,)): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
assert _is_sparse_variable(x) and _is_sparse_variable(gz) assert _is_sparse_variable(x) and _is_sparse_variable(gz)
if self.structured: if self.structured:
return sp_ones_like(x) * dense_from_sparse(gz), return sp_ones_like(x) * dense_from_sparse(gz),
......
...@@ -5159,10 +5159,14 @@ class Diagonal(Op): ...@@ -5159,10 +5159,14 @@ class Diagonal(Op):
return Apply(self, [x], [tensor(dtype=x.dtype, return Apply(self, [x], [tensor(dtype=x.dtype,
broadcastable=[False] * (x.ndim - 1))]) broadcastable=[False] * (x.ndim - 1))])
def perform(self, node, (x,), (z,)): def perform(self, node, inputs, outputs):
(x,) = inputs
(z,) = outputs
z[0] = x.diagonal(self.offset, self.axis1, self.axis2) z[0] = x.diagonal(self.offset, self.axis1, self.axis2)
def grad(self, (x,), (gz,)): def grad(self, inputs, gout):
(x,) = inputs
(gz,) = gout
return [grad_not_implemented(self, 0, x)] return [grad_not_implemented(self, 0, x)]
def infer_shape(self, node, shapes): def infer_shape(self, node, shapes):
...@@ -5207,10 +5211,12 @@ class Diag(Op): ...@@ -5207,10 +5211,12 @@ class Diag(Op):
return Apply(self, [diag], [matrix(dtype=diag.dtype)]) return Apply(self, [diag], [matrix(dtype=diag.dtype)])
def perform(self, node, inputs, (z,)): def perform(self, node, inputs, outputs):
(z,) = outputs
z[0] = numpy.diag(inputs[0]) z[0] = numpy.diag(inputs[0])
def grad(self, inputs, (gz,)): def grad(self, inputs, gout):
(gz,) = gout
return [diagonal(gz)] return [diagonal(gz)]
def infer_shape(self, nodes, shapes): def infer_shape(self, nodes, shapes):
...@@ -5435,7 +5441,8 @@ class Choose(Op): ...@@ -5435,7 +5441,8 @@ class Choose(Op):
o = TensorType(choice.dtype, bcast) o = TensorType(choice.dtype, bcast)
return Apply(self, [a, choice], [o()]) return Apply(self, [a, choice], [o()])
def perform(self, node, inputs, (z, )): def perform(self, node, inputs, outputs):
(z,) = outputs
a = inputs[0] a = inputs[0]
choice = inputs[1] choice = inputs[1]
# TODO reuse out? # TODO reuse out?
......
...@@ -593,7 +593,9 @@ class RepeatOp(theano.Op): ...@@ -593,7 +593,9 @@ class RepeatOp(theano.Op):
return [[True], [False]] return [[True], [False]]
def grad(self, (x, repeats), (gz, )): def grad(self, inputs, gout):
(x, repeats) = inputs
(gz,) = gout
if repeats.ndim == 0: if repeats.ndim == 0:
if self.axis is None: if self.axis is None:
axis = x.ndim axis = x.ndim
......
...@@ -42,7 +42,9 @@ class MatrixPinv(Op): ...@@ -42,7 +42,9 @@ class MatrixPinv(Op):
assert x.ndim == 2 assert x.ndim == 2
return Apply(self, [x], [x.type()]) return Apply(self, [x], [x.type()])
def perform(self, node, (x,), (z, )): def perform(self, node, inputs, outputs):
(x,) = inputs
(z,) = outputs
z[0] = numpy.linalg.pinv(x).astype(x.dtype) z[0] = numpy.linalg.pinv(x).astype(x.dtype)
pinv = MatrixPinv() pinv = MatrixPinv()
...@@ -69,7 +71,9 @@ class MatrixInverse(Op): ...@@ -69,7 +71,9 @@ class MatrixInverse(Op):
assert x.ndim == 2 assert x.ndim == 2
return Apply(self, [x], [x.type()]) return Apply(self, [x], [x.type()])
def perform(self, node, (x,), (z, )): def perform(self, node, inputs, outputs):
(x,) = inputs
(z,) = outputs
z[0] = numpy.linalg.inv(x).astype(x.dtype) z[0] = numpy.linalg.inv(x).astype(x.dtype)
def grad(self, inputs, g_outputs): def grad(self, inputs, g_outputs):
...@@ -149,7 +153,9 @@ class AllocDiag(Op): ...@@ -149,7 +153,9 @@ class AllocDiag(Op):
def grad(self, inputs, g_outputs): def grad(self, inputs, g_outputs):
return [extract_diag(g_outputs[0])] return [extract_diag(g_outputs[0])]
def perform(self, node, (x,), (z,)): def perform(self, node, inputs, outputs):
(x,) = inputs
(z,) = outputs
if x.ndim != 1: if x.ndim != 1:
raise TypeError(x) raise TypeError(x)
z[0] = numpy.diag(x) z[0] = numpy.diag(x)
...@@ -264,7 +270,9 @@ class Det(Op): ...@@ -264,7 +270,9 @@ class Det(Op):
o = theano.tensor.scalar(dtype=x.dtype) o = theano.tensor.scalar(dtype=x.dtype)
return Apply(self, [x], [o]) return Apply(self, [x], [o])
def perform(self, node, (x,), (z, )): def perform(self, node, inputs, outputs):
(x,) = inputs
(z,) = outputs
try: try:
z[0] = numpy.asarray(numpy.linalg.det(x), dtype=x.dtype) z[0] = numpy.asarray(numpy.linalg.det(x), dtype=x.dtype)
except Exception: except Exception:
...@@ -298,7 +306,9 @@ class Eig(Op): ...@@ -298,7 +306,9 @@ class Eig(Op):
v = theano.tensor.matrix(dtype=x.dtype) v = theano.tensor.matrix(dtype=x.dtype)
return Apply(self, [x], [w, v]) return Apply(self, [x], [w, v])
def perform(self, node, (x,), (w, v)): def perform(self, node, inputs, outputs):
(x,) = inputs
(w, v) = outputs
w[0], v[0] = [z.astype(x.dtype) for z in self._numop(x)] w[0], v[0] = [z.astype(x.dtype) for z in self._numop(x)]
def infer_shape(self, node, shapes): def infer_shape(self, node, shapes):
...@@ -333,7 +343,9 @@ class Eigh(Eig): ...@@ -333,7 +343,9 @@ class Eigh(Eig):
v = theano.tensor.matrix(dtype=x.dtype) v = theano.tensor.matrix(dtype=x.dtype)
return Apply(self, [x], [w, v]) return Apply(self, [x], [w, v])
def perform(self, node, (x,), (w, v)): def perform(self, node, inputs, outputs):
(x,) = inputs
(w, v) = outputs
w[0], v[0] = self._numop(x, self.UPLO) w[0], v[0] = self._numop(x, self.UPLO)
def grad(self, inputs, g_outputs): def grad(self, inputs, g_outputs):
...@@ -466,7 +478,9 @@ class QRFull(Op): ...@@ -466,7 +478,9 @@ class QRFull(Op):
return Apply(self, [x], [q, r]) return Apply(self, [x], [q, r])
def perform(self, node, (x,), (q, r)): def perform(self, node, inputs, outputs):
(x,) = inputs
(q, r) = outputs
assert x.ndim == 2, "The input of qr function should be a matrix." assert x.ndim == 2, "The input of qr function should be a matrix."
q[0], r[0] = self._numop(x, self.mode) q[0], r[0] = self._numop(x, self.mode)
...@@ -489,7 +503,9 @@ class QRIncomplete(Op): ...@@ -489,7 +503,9 @@ class QRIncomplete(Op):
q = theano.tensor.matrix(dtype=x.dtype) q = theano.tensor.matrix(dtype=x.dtype)
return Apply(self, [x], [q]) return Apply(self, [x], [q])
def perform(self, node, (x,), (q,)): def perform(self, node, inputs, outputs):
(x,) = inputs
(q,) = outputs
assert x.ndim == 2, "The input of qr function should be a matrix." assert x.ndim == 2, "The input of qr function should be a matrix."
q[0] = self._numop(x, q[0] = self._numop(x,
self.mode) self.mode)
...@@ -594,7 +610,9 @@ class SVD(Op): ...@@ -594,7 +610,9 @@ class SVD(Op):
v = theano.tensor.matrix(dtype=x.dtype) v = theano.tensor.matrix(dtype=x.dtype)
return Apply(self, [x], [w, u, v]) return Apply(self, [x], [w, u, v])
def perform(self, node, (x,), (w, u, v)): def perform(self, node, inputs, outputs):
(x,) = inputs
(w, u, v) = outputs
assert x.ndim == 2, "The input of svd function should be a matrix." assert x.ndim == 2, "The input of svd function should be a matrix."
w[0], u[0], v[0] = self._numop(x, w[0], u[0], v[0] = self._numop(x,
self.full_matrices, self.full_matrices,
......
...@@ -232,7 +232,8 @@ class Eigvalsh(Op): ...@@ -232,7 +232,8 @@ class Eigvalsh(Op):
w = theano.tensor.vector(dtype=out_dtype) w = theano.tensor.vector(dtype=out_dtype)
return Apply(self, [a, b], [w]) return Apply(self, [a, b], [w])
def perform(self, node, inputs, (w,)): def perform(self, node, inputs, outputs):
(w,) = outputs
if len(inputs) == 2: if len(inputs) == 2:
w[0] = scipy.linalg.eigvalsh(a=inputs[0], b=inputs[1], lower=self.lower) w[0] = scipy.linalg.eigvalsh(a=inputs[0], b=inputs[1], lower=self.lower)
else: else:
...@@ -288,7 +289,8 @@ class EigvalshGrad(Op): ...@@ -288,7 +289,8 @@ class EigvalshGrad(Op):
out2 = theano.tensor.matrix(dtype=out_dtype) out2 = theano.tensor.matrix(dtype=out_dtype)
return Apply(self, [a, b, gw], [out1, out2]) return Apply(self, [a, b, gw], [out1, out2])
def perform(self, node, (a, b, gw), outputs): def perform(self, node, inputs, outputs):
(a, b, gw) = inputs
w, v = scipy.linalg.eigh(a, b, lower=self.lower) w, v = scipy.linalg.eigh(a, b, lower=self.lower)
gA = v.dot(numpy.diag(gw).dot(v.T)) gA = v.dot(numpy.diag(gw).dot(v.T))
gB = - v.dot(numpy.diag(gw*w).dot(v.T)) gB = - v.dot(numpy.diag(gw*w).dot(v.T))
...@@ -353,10 +355,14 @@ class Expm(Op): ...@@ -353,10 +355,14 @@ class Expm(Op):
expm = theano.tensor.matrix(dtype=A.dtype) expm = theano.tensor.matrix(dtype=A.dtype)
return Apply(self, [A, ], [expm, ]) return Apply(self, [A, ], [expm, ])
def perform(self, node, (A,), (expm,)): def perform(self, node, inputs, outputs):
(A,) = inputs
(expm,) = outputs
expm[0] = scipy.linalg.expm(A) expm[0] = scipy.linalg.expm(A)
def grad(self, (A,), (g_out,)): def grad(self, inputs, outputs):
(A,) = inputs
(g_out,) = outputs
return [ExpmGrad()(A, g_out)] return [ExpmGrad()(A, g_out)]
def infer_shape(self, node, shapes): def infer_shape(self, node, shapes):
...@@ -378,10 +384,12 @@ class ExpmGrad(Op): ...@@ -378,10 +384,12 @@ class ExpmGrad(Op):
def infer_shape(self, node, shapes): def infer_shape(self, node, shapes):
return [shapes[0]] return [shapes[0]]
def perform(self, node, (A, gA), (out,)): def perform(self, node, inputs, outputs):
# Kalbfleisch and Lawless, J. Am. Stat. Assoc. 80 (1985) Equation 3.4 # Kalbfleisch and Lawless, J. Am. Stat. Assoc. 80 (1985) Equation 3.4
# Kind of... You need to do some algebra from there to arrive at # Kind of... You need to do some algebra from there to arrive at
# this expression. # this expression.
(A, gA) = inputs
(out,) = outputs
w, V = scipy.linalg.eig(A, right=True) w, V = scipy.linalg.eig(A, right=True)
U = scipy.linalg.inv(V).T U = scipy.linalg.inv(V).T
......
...@@ -1233,7 +1233,9 @@ def test_not_implemented_elemwise_grad(): ...@@ -1233,7 +1233,9 @@ def test_not_implemented_elemwise_grad():
def impl(self, n, x): def impl(self, n, x):
return x * n return x * n
def grad(self, (n, x), (gz,)): def grad(self, inputs, gout):
(n, x) = inputs
(gz,) = gout
dy_dx = n dy_dx = n
return [theano.gradient.grad_not_implemented(self, 0, n), return [theano.gradient.grad_not_implemented(self, 0, n),
gz * dy_dx] gz * dy_dx]
......
...@@ -1421,7 +1421,9 @@ class TimesN(theano.scalar.basic.UnaryScalarOp): ...@@ -1421,7 +1421,9 @@ class TimesN(theano.scalar.basic.UnaryScalarOp):
float %(nodename)s_timesn(float x) { return x * %(n)s; } float %(nodename)s_timesn(float x) { return x * %(n)s; }
""" % locals() """ % locals()
def c_code(self, node, name, (x, ), (z, ), sub): def c_code(self, node, name, inputs, outputs, sub):
(x,) = inputs
(z,) = outputs
return "%(z)s = %(name)s_timesn(%(x)s);" % locals() return "%(z)s = %(name)s_timesn(%(x)s);" % locals()
......
...@@ -80,7 +80,9 @@ class GetItem(Op): ...@@ -80,7 +80,9 @@ class GetItem(Op):
else: else:
raise TypeError('Expected scalar or slice as index.') raise TypeError('Expected scalar or slice as index.')
def perform(self, node, (x, index), (out, )): def perform(self, node, inputs, outputs):
(x, index) = inputs
(out,) = outputs
if not isinstance(index, slice): if not isinstance(index, slice):
index = int(index) index = int(index)
out[0] = x[index] out[0] = x[index]
...@@ -137,7 +139,9 @@ class Append(Op): ...@@ -137,7 +139,9 @@ class Append(Op):
assert x.ttype == toAppend.type, (x.ttype, toAppend.type) assert x.ttype == toAppend.type, (x.ttype, toAppend.type)
return Apply(self, [x, toAppend], [x.type()]) return Apply(self, [x, toAppend], [x.type()])
def perform(self, node, (x, toAppend), (out, )): def perform(self, node, inputs, outputs):
(x, toAppend) = inputs
(out,) = outputs
if not self.inplace: if not self.inplace:
out[0] = list(x) out[0] = list(x)
else: else:
...@@ -209,7 +213,9 @@ class Extend(Op): ...@@ -209,7 +213,9 @@ class Extend(Op):
assert x.type == toAppend.type assert x.type == toAppend.type
return Apply(self, [x, toAppend], [x.type()]) return Apply(self, [x, toAppend], [x.type()])
def perform(self, node, (x, toAppend), (out, )): def perform(self, node, inputs, outputs):
(x, toAppend) = inputs
(out,) = outputs
if not self.inplace: if not self.inplace:
out[0] = list(x) out[0] = list(x)
else: else:
...@@ -292,7 +298,9 @@ class Insert(Op): ...@@ -292,7 +298,9 @@ class Insert(Op):
assert isinstance(index, T.TensorVariable) and index.ndim == 0 assert isinstance(index, T.TensorVariable) and index.ndim == 0
return Apply(self, [x, index, toInsert], [x.type()]) return Apply(self, [x, index, toInsert], [x.type()])
def perform(self, node, (x, index, toInsert), (out, )): def perform(self, node, inputs, outputs):
(x, index, toInsert) = inputs
(out,) = outputs
if not self.inplace: if not self.inplace:
out[0] = list(x) out[0] = list(x)
else: else:
...@@ -360,8 +368,9 @@ class Remove(Op): ...@@ -360,8 +368,9 @@ class Remove(Op):
assert x.ttype == toRemove.type assert x.ttype == toRemove.type
return Apply(self, [x, toRemove], [x.type()]) return Apply(self, [x, toRemove], [x.type()])
def perform(self, node, (x, toRemove), (out, )): def perform(self, node, inputs, outputs):
(x, toRemove) = inputs
(out,) = outputs
if not self.inplace: if not self.inplace:
out[0] = list(x) out[0] = list(x)
else: else:
...@@ -413,8 +422,8 @@ class Reverse(Op): ...@@ -413,8 +422,8 @@ class Reverse(Op):
assert isinstance(x.type, TypedListType) assert isinstance(x.type, TypedListType)
return Apply(self, [x], [x.type()]) return Apply(self, [x], [x.type()])
def perform(self, node, inp, (out, )): def perform(self, node, inp, outputs):
(out,) = outputs
if not self.inplace: if not self.inplace:
out[0] = list(inp[0]) out[0] = list(inp[0])
else: else:
...@@ -470,12 +479,14 @@ class Index(Op): ...@@ -470,12 +479,14 @@ class Index(Op):
assert x.ttype == elem.type assert x.ttype == elem.type
return Apply(self, [x, elem], [T.scalar()]) return Apply(self, [x, elem], [T.scalar()])
def perform(self, node, (x, elem), (out, )): def perform(self, node, inputs, outputs):
""" """
inelegant workaround for ValueError: The truth value of an inelegant workaround for ValueError: The truth value of an
array with more than one element is ambiguous. Use a.any() or a.all() array with more than one element is ambiguous. Use a.any() or a.all()
being thrown when trying to remove a matrix from a matrices list being thrown when trying to remove a matrix from a matrices list
""" """
(x, elem) = inputs
(out,) = outputs
for y in range(len(x)): for y in range(len(x)):
if node.inputs[0].ttype.values_eq(x[y], elem): if node.inputs[0].ttype.values_eq(x[y], elem):
out[0] = numpy.asarray(y, dtype=theano.config.floatX) out[0] = numpy.asarray(y, dtype=theano.config.floatX)
...@@ -500,12 +511,14 @@ class Count(Op): ...@@ -500,12 +511,14 @@ class Count(Op):
assert x.ttype == elem.type assert x.ttype == elem.type
return Apply(self, [x, elem], [T.scalar()]) return Apply(self, [x, elem], [T.scalar()])
def perform(self, node, (x, elem), (out, )): def perform(self, node, inputs, outputs):
""" """
inelegant workaround for ValueError: The truth value of an inelegant workaround for ValueError: The truth value of an
array with more than one element is ambiguous. Use a.any() or a.all() array with more than one element is ambiguous. Use a.any() or a.all()
being thrown when trying to remove a matrix from a matrices list being thrown when trying to remove a matrix from a matrices list
""" """
(x, elem) = inputs
(out,) = outputs
out[0] = 0 out[0] = 0
for y in range(len(x)): for y in range(len(x)):
if node.inputs[0].ttype.values_eq(x[y], elem): if node.inputs[0].ttype.values_eq(x[y], elem):
...@@ -543,7 +556,8 @@ class Length(Op): ...@@ -543,7 +556,8 @@ class Length(Op):
assert isinstance(x.type, TypedListType) assert isinstance(x.type, TypedListType)
return Apply(self, [x], [T.scalar(dtype='int64')]) return Apply(self, [x], [T.scalar(dtype='int64')])
def perform(self, node, x, (out, )): def perform(self, node, x, outputs):
(out,) = outputs
out[0] = numpy.asarray(len(x[0]), 'int64') out[0] = numpy.asarray(len(x[0]), 'int64')
def __str__(self): def __str__(self):
...@@ -593,7 +607,8 @@ class MakeList(Op): ...@@ -593,7 +607,8 @@ class MakeList(Op):
return Apply(self, a2, [tl]) return Apply(self, a2, [tl])
def perform(self, node, inputs, (out, )): def perform(self, node, inputs, outputs):
(out,) = outputs
out[0] = list(inputs) out[0] = list(inputs)
make_list = MakeList() make_list = MakeList()
......
Markdown 格式
0%
您添加了 0 到此讨论。请谨慎行事。
请先完成此评论的编辑!
注册 或者 后发表评论